Aspergiloid A
| Internal ID | 0e757936-e5ee-497f-a8e5-a53dda5e7f34 |
| Taxonomy | Organoheterocyclic compounds > Naphthopyrans |
| IUPAC Name | (9S,12S)-12-hydroxy-9-methoxy-6,6,14-trimethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),13,15-tetraen-8-one |
| SMILES (Canonical) | CC1=C2C(COC3(C2=C(C=C1)C4=C(C3=O)C(CCC4)(C)C)OC)O |
| SMILES (Isomeric) | CC1=C2[C@@H](CO[C@]3(C2=C(C=C1)C4=C(C3=O)C(CCC4)(C)C)OC)O |
| InChI | InChI=1S/C20H24O4/c1-11-7-8-13-12-6-5-9-19(2,3)17(12)18(22)20(23-4)16(13)15(11)14(21)10-24-20/h7-8,14,21H,5-6,9-10H2,1-4H3/t14-,20+/m1/s1 |
| InChI Key | PRQPFHSCPMOHHX-VLIAUNLRSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.16745924 g/mol |
| Topological Polar Surface Area (TPSA) | 55.80 Ų |
| XlogP | 2.70 |
| (9S,12S)-12-hydroxy-9-methoxy-6,6,14-trimethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),13,15-tetraen-8-one |
| (9S,12S)-12-hydroxy-9-methoxy-6,6,14-trimethyl-10-oxatetracyclo(7.7.1.02,7.013,17)heptadeca-1(17),2(7),13,15-tetraen-8-one |
| RefChem:114846 |
| CHEMBL1951871 |
| CHEBI:205127 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 99.76% | 91.49% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.42% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.83% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.46% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.54% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.76% | 95.89% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.97% | 97.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.65% | 94.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.44% | 89.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.39% | 100.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.68% | 99.23% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.47% | 94.75% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.50% | 92.62% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.20% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.47% | 97.25% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.30% | 94.73% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 82.25% | 96.38% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 80.29% | 90.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 57333709 |
| LOTUS | LTS0132575 |
| wikiData | Q77422247 |