Asn-Leu-Phe-Asp
| Internal ID | 86f45bea-5296-41d0-a4ec-7c9bcf2835bb |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2,4-diamino-4-oxobutanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]butanedioic acid |
| SMILES (Canonical) | CC(C)CC(C(=O)NC(CC1=CC=CC=C1)C(=O)NC(CC(=O)O)C(=O)O)NC(=O)C(CC(=O)N)N |
| SMILES (Isomeric) | CC(C)C[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CC(=O)O)C(=O)O)NC(=O)[C@H](CC(=O)N)N |
| InChI | InChI=1S/C23H33N5O8/c1-12(2)8-15(26-20(32)14(24)10-18(25)29)21(33)27-16(9-13-6-4-3-5-7-13)22(34)28-17(23(35)36)11-19(30)31/h3-7,12,14-17H,8-11,24H2,1-2H3,(H2,25,29)(H,26,32)(H,27,33)(H,28,34)(H,30,31)(H,35,36)/t14-,15-,16-,17-/m0/s1 |
| InChI Key | MHBUWPFQNPJTAS-QAETUUGQSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C23H33N5O8 |
| Molecular Weight | 507.50 g/mol |
| Exact Mass | 507.23291303 g/mol |
| Topological Polar Surface Area (TPSA) | 231.00 Ų |
| XlogP | -3.30 |
| NLFD |
| N-L-F-D |
| L-Asn-L-Leu-L-Phe-L-Asp |
| SCHEMBL29629126 |
| CHEBI:73411 |
| L-asparaginyl-L-leucyl-L-phenylalanyl-L-aspartic acid |
| Q27140501 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.72% | 98.95% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 99.56% | 90.17% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 98.22% | 90.20% |
| CHEMBL3837 | P07711 | Cathepsin L | 97.74% | 96.61% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.77% | 96.09% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 95.49% | 93.56% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 93.85% | 83.82% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 93.08% | 100.00% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 90.15% | 98.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.07% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.16% | 99.17% |
| CHEMBL4801 | P29466 | Caspase-1 | 86.48% | 96.85% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 86.33% | 97.23% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 85.61% | 100.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.37% | 95.50% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.78% | 93.00% |
| CHEMBL3891 | P07384 | Calpain 1 | 82.97% | 93.04% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.95% | 91.11% |
| CHEMBL209 | P07477 | Trypsin I | 82.45% | 90.00% |
| CHEMBL2095164 | P49354 | Geranylgeranyl transferase type I | 81.45% | 92.80% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.44% | 96.00% |
| CHEMBL5028 | O14672 | ADAM10 | 81.31% | 97.50% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.48% | 97.21% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 80.17% | 92.29% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 71464615 |
| LOTUS | LTS0084342 |
| wikiData | Q27140501 |