Articulin
| Internal ID | 6039a8b5-7984-42f0-b189-8a048d432f35 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Diterpene lactones |
| IUPAC Name | 5-hydroxy-7,8-dimethyl-7-[2-(5-oxo-2H-furan-3-yl)ethyl]-5,6,6a,8,9,10-hexahydro-1H-benzo[d][2]benzofuran-3-one |
| SMILES (Canonical) | CC1CCC23COC(=O)C2=CC(CC3C1(C)CCC4=CC(=O)OC4)O |
| SMILES (Isomeric) | CC1CCC23COC(=O)C2=CC(CC3C1(C)CCC4=CC(=O)OC4)O |
| InChI | InChI=1S/C20H26O5/c1-12-3-6-20-11-25-18(23)15(20)8-14(21)9-16(20)19(12,2)5-4-13-7-17(22)24-10-13/h7-8,12,14,16,21H,3-6,9-11H2,1-2H3 |
| InChI Key | CIYUVACHWWSUHM-UHFFFAOYSA-N |
| Popularity | 9 references in papers |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.17802393 g/mol |
| Topological Polar Surface Area (TPSA) | 72.80 Ų |
| XlogP | 2.50 |
| Articulin |
| 75478-98-7 |
| RefChem:114333 |
| 5-hydroxy-7,8-dimethyl-7-[2-(5-oxo-2H-furan-3-yl)ethyl]-5,6,6a,8,9,10-hexahydro-1H-benzo[d][2]benzofuran-3-one |
| 80 kD Articulin |
| 86 kD Articulin |
| 80 kDa articulin |
| DTXSID60996930 |
| 1H-Naphtho(1,8a-c)furan-3(5H)-one, 7-(2-(2,5-dihydro-5-oxo-3-furanyl)ethyl)-6,6a,7,8,9,10-hexahydro-5-hydroxy-7,8-dimethyl-, (5S-(5alpha,6aalpha,7alpha,8beta,10aR*))- |
| 5-Hydroxy-7,8-dimethyl-7-[2-(5-oxo-2,5-dihydrofuran-3-yl)ethyl]-6,6a,7,8,9,10-hexahydro-1H-naphtho[1,8a-c]furan-3(5H)-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.43% | 91.11% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 97.33% | 82.69% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 95.62% | 95.93% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.31% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.16% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.81% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.56% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.99% | 95.56% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.87% | 100.00% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 89.43% | 96.61% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.90% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.12% | 86.33% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 85.94% | 89.63% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 83.64% | 97.33% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.45% | 94.75% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.66% | 90.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Solidago gigantea |
| PubChem | 156833 |
| LOTUS | LTS0181406 |
| wikiData | Q82988852 |