Arthpyrone D
| Internal ID | 3c078ad3-3c22-4da8-843a-db7c72d64231 |
| Taxonomy | Organoheterocyclic compounds > Pyranopyridines |
| IUPAC Name | [(1R,9S,10S,13S)-1,10,13-trihydroxy-5-oxo-8-oxa-4-azatricyclo[7.3.1.02,7]trideca-2,6-dien-6-yl] (1R,2R,4aS,6R,8aR)-2,6-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carboxylate |
| SMILES (Canonical) | CC1CCC2C(C1)C=CC(C2C(=O)OC3=C4C(=CNC3=O)C5(CCC(C(C5O)O4)O)O)C |
| SMILES (Isomeric) | C[C@@H]1CC[C@@H]2[C@@H](C1)C=C[C@H]([C@H]2C(=O)OC3=C4C(=CNC3=O)[C@@]5(CC[C@@H]([C@@H]([C@@H]5O)O4)O)O)C |
| InChI | InChI=1S/C24H31NO7/c1-11-3-6-14-13(9-11)5-4-12(2)17(14)23(29)32-20-18-15(10-25-22(20)28)24(30)8-7-16(26)19(31-18)21(24)27/h4-5,10-14,16-17,19,21,26-27,30H,3,6-9H2,1-2H3,(H,25,28)/t11-,12-,13-,14-,16+,17-,19+,21+,24-/m1/s1 |
| InChI Key | IVQSLLHVPILGQY-CSCCFPDDSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C24H31NO7 |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.21005233 g/mol |
| Topological Polar Surface Area (TPSA) | 125.00 Ų |
| XlogP | 1.20 |
| [(1R,9S,10S,13S)-1,10,13-trihydroxy-5-oxo-8-oxa-4-azatricyclo[7.3.1.02,7]trideca-2,6-dien-6-yl] (1R,2R,4aS,6R,8aR)-2,6-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carboxylate |
| ((1R,9S,10S,13S)-1,10,13-trihydroxy-5-oxo-8-oxa-4-azatricyclo(7.3.1.02,7)trideca-2,6-dien-6-yl) (1R,2R,4aS,6R,8aR)-2,6-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carboxylate |
| RefChem:114286 |
| CHEBI:213473 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.55% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.86% | 97.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.12% | 97.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.10% | 94.45% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.80% | 99.23% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.44% | 96.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.36% | 100.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.13% | 89.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.92% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.65% | 95.56% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.48% | 93.04% |
| CHEMBL2850 | P49840 | Glycogen synthase kinase-3 alpha | 83.96% | 88.84% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 83.89% | 95.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.44% | 86.33% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 81.79% | 97.28% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.61% | 100.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.60% | 92.94% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 80.92% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139590615 |
| LOTUS | LTS0069401 |
| wikiData | Q105121232 |