Arsindoline A
| Internal ID | 6a95aaa9-0b46-4894-b845-151e34de8cfa |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives |
| IUPAC Name | 4-[bis(1H-indol-3-yl)methyl]quinoline |
| SMILES (Canonical) | C1=CC=C2C(=C1)C(=CN2)C(C3=CC=NC4=CC=CC=C34)C5=CNC6=CC=CC=C65 |
| SMILES (Isomeric) | C1=CC=C2C(=C1)C(=CN2)C(C3=CC=NC4=CC=CC=C34)C5=CNC6=CC=CC=C65 |
| InChI | InChI=1S/C26H19N3/c1-4-10-23-17(7-1)20(13-14-27-23)26(21-15-28-24-11-5-2-8-18(21)24)22-16-29-25-12-6-3-9-19(22)25/h1-16,26,28-29H |
| InChI Key | RPCIMQHNQDHPPO-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C26H19N3 |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.157897619 g/mol |
| Topological Polar Surface Area (TPSA) | 44.50 Ų |
| XlogP | 5.80 |
| SCHEMBL18622059 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.02% | 91.11% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 93.66% | 92.67% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 92.29% | 94.62% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 90.20% | 91.49% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 89.51% | 88.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.48% | 89.00% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 88.72% | 89.44% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 88.57% | 98.59% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.93% | 98.75% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 87.76% | 96.47% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 85.69% | 96.39% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.28% | 94.00% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 84.48% | 91.38% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.27% | 98.95% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 84.18% | 93.81% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 84.15% | 80.96% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.75% | 94.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.01% | 95.56% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 82.89% | 83.10% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 82.70% | 95.56% |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 81.25% | 90.71% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.01% | 96.09% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 80.92% | 92.97% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.77% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 46217850 |
| LOTUS | LTS0061044 |
| wikiData | Q105379820 |