Armochaetoglobin L
| Internal ID | ae1c1303-d506-478c-a71e-6ddf136b6d1e |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indoles > 3-alkylindoles |
| IUPAC Name | (2S,5S,6R,7S,10S,14S)-8-(hydroxymethyl)-5-(1H-indol-3-ylmethyl)-7,14,16-trimethyl-4,21-diazatetracyclo[16.2.1.02,6.02,10]henicosa-1(20),8,11,15,18-pentaene-3,17-dione |
| SMILES (Canonical) | CC1CC=CC2C=C(C(C3C2(C4=CC=C(N4)C(=O)C(=C1)C)C(=O)NC3CC5=CNC6=CC=CC=C65)C)CO |
| SMILES (Isomeric) | C[C@H]1CC=C[C@H]2C=C([C@H]([C@@H]3[C@@]2(C4=CC=C(N4)C(=O)C(=C1)C)C(=O)N[C@H]3CC5=CNC6=CC=CC=C65)C)CO |
| InChI | InChI=1S/C32H35N3O3/c1-18-7-6-8-23-14-22(17-36)20(3)29-27(15-21-16-33-25-10-5-4-9-24(21)25)35-31(38)32(23,29)28-12-11-26(34-28)30(37)19(2)13-18/h4-6,8-14,16,18,20,23,27,29,33-34,36H,7,15,17H2,1-3H3,(H,35,38)/t18-,20+,23-,27-,29-,32+/m0/s1 |
| InChI Key | RUJBSNUQPZHAFN-YORJNJFPSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C32H35N3O3 |
| Molecular Weight | 509.60 g/mol |
| Exact Mass | 509.26784199 g/mol |
| Topological Polar Surface Area (TPSA) | 98.00 Ų |
| XlogP | 4.40 |
| (2S,5S,6R,7S,10S,14S)-8-(hydroxymethyl)-5-(1H-indol-3-ylmethyl)-7,14,16-trimethyl-4,21-diazatetracyclo[16.2.1.02,6.02,10]henicosa-1(20),8,11,15,18-pentaene-3,17-dione |
| (2S,5S,6R,7S,10S,14S)-8-(hydroxymethyl)-5-(1H-indol-3-ylmethyl)-7,14,16-trimethyl-4,21-diazatetracyclo(16.2.1.02,6.02,10)henicosa-1(20),8,11,15,18-pentaene-3,17-dione |
| RefChem:114136 |
| CHEBI:219630 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 98.62% | 94.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 98.54% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.37% | 91.11% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 97.97% | 93.99% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.22% | 98.95% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 97.01% | 88.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.06% | 96.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.13% | 99.23% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 93.00% | 98.59% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 92.79% | 90.08% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.39% | 89.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.06% | 97.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.69% | 94.00% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 87.71% | 96.39% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.68% | 85.14% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 84.71% | 96.90% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 84.57% | 94.62% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 82.71% | 97.64% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.62% | 94.45% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.39% | 92.62% |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 82.34% | 90.71% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.49% | 100.00% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.21% | 89.62% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.04% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139587521 |
| LOTUS | LTS0124214 |
| wikiData | Q77568067 |