Ardisiamamilloside C
Internal ID | 9038a36d-330d-4220-848d-4565b1055871 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (2S,3R,4R,5R,6R)-2-[(2S,3R,4S,5S,6R)-2-[(3S,4S,5R,6S)-6-[[(3S,4aR,6aR,6bS,8R,8aS,11S,12aS,14aR,14bR)-8-hydroxy-8a,11-bis(hydroxymethyl)-4,4,6a,6b,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-4-hydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-3-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3COC(C(C3O)OC4C(C(C(C(O4)CO)O)O)O)OC5CCC6(C(C5(C)C)CCC7(C6CC=C8C7(CC(C9(C8CC(CC9)(C)CO)CO)O)C)C)C)CO)O)O)O)O)O |
SMILES (Isomeric) | C[C@@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H]([C@H](O[C@H]2O[C@H]3CO[C@H]([C@@H]([C@H]3O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O[C@H]5CC[C@]6([C@H](C5(C)C)CC[C@@]7([C@@H]6CC=C8[C@]7(C[C@H]([C@@]9([C@H]8C[C@@](CC9)(C)CO)CO)O)C)C)C)CO)O)O)O)O)O |
InChI | InChI=1S/C53H88O22/c1-23-33(59)37(63)40(66)44(69-23)75-43-39(65)35(61)27(19-55)71-47(43)72-28-20-68-46(42(36(28)62)74-45-41(67)38(64)34(60)26(18-54)70-45)73-32-11-12-50(5)29(48(32,2)3)10-13-51(6)30(50)9-8-24-25-16-49(4,21-56)14-15-53(25,22-57)31(58)17-52(24,51)7/h8,23,25-47,54-67H,9-22H2,1-7H3/t23-,25+,26-,27-,28+,29+,30-,31-,32+,33+,34-,35-,36+,37-,38+,39+,40-,41-,42-,43-,44+,45+,46+,47+,49+,50+,51-,52-,53-/m1/s1 |
InChI Key | FUEJSDQPLRTIHO-OGGAYLCISA-N |
Popularity | 0 references in papers |
Molecular Formula | C53H88O22 |
Molecular Weight | 1077.30 g/mol |
Exact Mass | 1076.57672443 g/mol |
Topological Polar Surface Area (TPSA) | 357.00 Ų |
XlogP | -0.40 |
(-)-Ardisiamamilloside C |
![2D Structure of Ardisiamamilloside C 2D Structure of Ardisiamamilloside C](https://plantaedb.com/storage/docs/compounds/2023/11/ardisiamamilloside-c.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.05% | 91.11% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.94% | 90.17% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 92.72% | 95.93% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.10% | 96.09% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 91.61% | 97.36% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 90.72% | 96.21% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.77% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.78% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.93% | 100.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.44% | 94.00% |
CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 85.53% | 94.50% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.22% | 96.61% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.09% | 92.94% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.31% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.31% | 86.33% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 81.60% | 89.67% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.15% | 94.75% |
CHEMBL5028 | O14672 | ADAM10 | 80.89% | 97.50% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 80.10% | 89.44% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ardisia japonica |
Ardisia mamillata |
PubChem | 162852295 |
LOTUS | LTS0120311 |
wikiData | Q105001636 |