Arbusculin B
Internal ID | b3f677a9-a671-47a5-9020-afb2d24746b7 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Sesquiterpene lactones > Eudesmanolides, secoeudesmanolides, and derivatives |
IUPAC Name | (3aS,5aR,9bS)-5a,9-dimethyl-3-methylidene-4,5,6,7,8,9b-hexahydro-3aH-benzo[g][1]benzofuran-2-one |
SMILES (Canonical) | CC1=C2C3C(CCC2(CCC1)C)C(=C)C(=O)O3 |
SMILES (Isomeric) | CC1=C2[C@@H]3[C@@H](CC[C@]2(CCC1)C)C(=C)C(=O)O3 |
InChI | InChI=1S/C15H20O2/c1-9-5-4-7-15(3)8-6-11-10(2)14(16)17-13(11)12(9)15/h11,13H,2,4-8H2,1,3H3/t11-,13-,15+/m0/s1 |
InChI Key | PJPHIAMRKUNVSU-CORIIIEPSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C15H20O2 |
Molecular Weight | 232.32 g/mol |
Exact Mass | 232.146329876 g/mol |
Topological Polar Surface Area (TPSA) | 26.30 Ų |
XlogP | 3.10 |
Arbusculin B |
gamma-Cyclocostunolide |
3a,4,5,5a,6,7,8,9b-Octahydro-5a,9-dimethyl-3-methylenenaphtho(1,2-b)furan-2(3H)-one (3aS-(3aalpha,5abeta,9bbeta))- |
MEGxp0_001635 |
ACon0_000566 |
DTXSID80946992 |
Eudesma-4,11(13)-dien-12-oic acid, 6-alpha-hydroxy-, gamma-lactone |
Naphtho(1,2-b)furan-2(3H)-one, 3a,4,5,5a,6,7,8,9b-octahydro-5a,9-dimethyl-3-methylene-, (3aS-(3aalpha,5abeta,9bbeta))- |
5a,9-Dimethyl-3-methylidene-3a,4,5,5a,6,7,8,9b-octahydronaphtho[1,2-b]furan-2(3H)-one |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.28% | 97.25% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.07% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.45% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.21% | 97.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.43% | 99.23% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.04% | 94.45% |
CHEMBL3012 | Q13946 | Phosphodiesterase 7A | 84.73% | 99.29% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.83% | 100.00% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.46% | 93.03% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 83.41% | 93.04% |
CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 82.56% | 96.25% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.08% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 81.60% | 98.95% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.82% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 161442 |
LOTUS | LTS0071882 |
wikiData | Q82924740 |