arbortristoside C
Internal ID | 3b4e4630-00d1-4213-be0a-48cd38852ae7 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Iridoid O-glycosides |
IUPAC Name | methyl (1S,4aS,5S,6R,7R,7aR)-5-hydroxy-6-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
SMILES (Canonical) | CC1C2C(C(C1OC(=O)C=CC3=CC=C(C=C3)O)O)C(=COC2OC4C(C(C(C(O4)CO)O)O)O)C(=O)OC |
SMILES (Isomeric) | C[C@@H]1[C@@H]2[C@H]([C@@H]([C@@H]1OC(=O)/C=C/C3=CC=C(C=C3)O)O)C(=CO[C@H]2O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)C(=O)OC |
InChI | InChI=1S/C26H32O13/c1-11-17-18(20(31)23(11)38-16(29)8-5-12-3-6-13(28)7-4-12)14(24(34)35-2)10-36-25(17)39-26-22(33)21(32)19(30)15(9-27)37-26/h3-8,10-11,15,17-23,25-28,30-33H,9H2,1-2H3/b8-5+/t11-,15-,17-,18-,19-,20+,21+,22-,23-,25+,26+/m1/s1 |
InChI Key | OJZQWQZTFYKVNT-KBLKYLEWSA-N |
Popularity | 2 references in papers |
Molecular Formula | C26H32O13 |
Molecular Weight | 552.50 g/mol |
Exact Mass | 552.18429107 g/mol |
Topological Polar Surface Area (TPSA) | 202.00 Ų |
XlogP | -0.10 |
CHEMBL505478 |
MEGxp0_001266 |
ACon1_001182 |
NCGC00169599-01 |
BRD-K10013404-001-01-6 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.99% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.12% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.11% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.06% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.94% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.05% | 94.73% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.61% | 89.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.93% | 90.00% |
CHEMBL2581 | P07339 | Cathepsin D | 82.17% | 98.95% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.91% | 92.50% |
CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 81.65% | 88.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.38% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.19% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Nyctanthes arbor-tristis |
PubChem | 23955893 |
LOTUS | LTS0206337 |
wikiData | Q105193410 |