Aquachelin J
| Internal ID | 121ed30e-a3f5-44a1-a4ce-79820cbc6cc2 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | 5-[acetyl(hydroxy)amino]-2-[[2-[[5-[acetyl(hydroxy)amino]-2-[[5-amino-2-[[2-[[2-[[3-carboxy-2-(decanoylamino)-3-hydroxypropanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxypropanoyl]amino]-5-oxopentanoyl]amino]pentanoyl]amino]-3-hydroxypropanoyl]amino]pentanoic acid |
| SMILES (Canonical) | CCCCCCCCCC(=O)NC(C(C(=O)O)O)C(=O)NC(CO)C(=O)NC(CO)C(=O)NC(CCC(=O)N)C(=O)NC(CCCN(C(=O)C)O)C(=O)NC(CO)C(=O)NC(CCCN(C(=O)C)O)C(=O)O |
| SMILES (Isomeric) | CCCCCCCCCC(=O)NC(C(C(=O)O)O)C(=O)NC(CO)C(=O)NC(CO)C(=O)NC(CCC(=O)N)C(=O)NC(CCCN(C(=O)C)O)C(=O)NC(CO)C(=O)NC(CCCN(C(=O)C)O)C(=O)O |
| InChI | InChI=1S/C42H72N10O20/c1-4-5-6-7-8-9-10-15-32(59)50-33(34(60)42(69)70)40(66)49-30(22-55)39(65)48-28(20-53)37(63)45-26(16-17-31(43)58)36(62)44-25(13-11-18-51(71)23(2)56)35(61)47-29(21-54)38(64)46-27(41(67)68)14-12-19-52(72)24(3)57/h25-30,33-34,53-55,60,71-72H,4-22H2,1-3H3,(H2,43,58)(H,44,62)(H,45,63)(H,46,64)(H,47,61)(H,48,65)(H,49,66)(H,50,59)(H,67,68)(H,69,70) |
| InChI Key | BCCHXUONKCNFBI-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C42H72N10O20 |
| Molecular Weight | 1037.10 g/mol |
| Exact Mass | 1036.49243472 g/mol |
| Topological Polar Surface Area (TPSA) | 483.00 Ų |
| XlogP | -4.90 |
| 5-[acetyl(hydroxy)amino]-2-[[2-[[5-[acetyl(hydroxy)amino]-2-[[5-amino-2-[[2-[[2-[[3-carboxy-2-(decanoylamino)-3-hydroxypropanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxypropanoyl]amino]-5-oxopentanoyl]amino]pentanoyl]amino]-3-hydroxypropanoyl]amino]pentanoic acid |
| 2-((2-((2-((2-((2-((2-((3-carboxy-1,3-dihydroxy-2-((1-hydroxydecylidene)amino)propylidene)amino)-1,3-dihydroxypropylidene)amino)-1,3-dihydroxypropylidene)amino)-1-hydroxy-4-(C-hydroxycarbonimidoyl)butylidene)amino)-1-hydroxy-5-(N-hydroxyacetamido)pentylidene)amino)-1,3-dihydroxypropylidene)amino)-5-(N-hydroxyacetamido)pentanoate |
| 2-[(2-{[2-({2-[(2-{[2-({3-carboxy-1,3-dihydroxy-2-[(1-hydroxydecylidene)amino]propylidene}amino)-1,3-dihydroxypropylidene]amino}-1,3-dihydroxypropylidene)amino]-1-hydroxy-4-(C-hydroxycarbonimidoyl)butylidene}amino)-1-hydroxy-5-(N-hydroxyacetamido)pentylidene]amino}-1,3-dihydroxypropylidene)amino]-5-(N-hydroxyacetamido)pentanoate |
| 5-(acetyl(hydroxy)amino)-2-((2-((5-(acetyl(hydroxy)amino)-2-((5-amino-2-((2-((2-((3-carboxy-2-(decanoylamino)-3-hydroxypropanoyl)amino)-3-hydroxypropanoyl)amino)-3-hydroxypropanoyl)amino)-5-oxopentanoyl)amino)pentanoyl)amino)-3-hydroxypropanoyl)amino)pentanoic acid |
| RefChem:113597 |
| SCHEMBL29855473 |
| CHEBI:217775 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.33% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.11% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 98.89% | 99.17% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.23% | 90.17% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 96.77% | 97.29% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 96.69% | 93.56% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 94.29% | 91.81% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.95% | 96.09% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 92.85% | 100.00% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 91.82% | 95.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 91.68% | 93.00% |
| CHEMBL3629 | P68400 | Casein kinase II alpha | 91.08% | 98.89% |
| CHEMBL236 | P41143 | Delta opioid receptor | 90.47% | 99.35% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 90.31% | 92.86% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 90.00% | 92.08% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 89.78% | 89.63% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 89.24% | 82.69% |
| CHEMBL3776 | Q14790 | Caspase-8 | 88.77% | 97.06% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 88.53% | 98.33% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 88.52% | 100.00% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 88.45% | 95.17% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.10% | 91.19% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 87.50% | 92.29% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 87.42% | 96.00% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 87.14% | 98.94% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 86.98% | 87.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.74% | 91.11% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.97% | 100.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.19% | 96.00% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 85.05% | 93.10% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 85.05% | 95.38% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 84.71% | 96.90% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.14% | 94.45% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 84.10% | 97.50% |
| CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 83.45% | 97.43% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 83.42% | 90.20% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.37% | 96.47% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 82.52% | 97.23% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 82.13% | 92.32% |
| CHEMBL3837 | P07711 | Cathepsin L | 82.09% | 96.61% |
| CHEMBL203 | P00533 | Epidermal growth factor receptor erbB1 | 81.99% | 97.34% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 81.99% | 98.05% |
| CHEMBL3018 | Q9Y5Y6 | Matriptase | 81.46% | 98.33% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 80.75% | 96.28% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139587424 |
| LOTUS | LTS0123931 |
| wikiData | Q77565731 |