Aptosimone
Internal ID | ea7fc7f3-fb60-4d3f-a57c-caf37df3a020 |
Taxonomy | Lignans, neolignans and related compounds > Lignan lactones |
IUPAC Name | (3S,3aS,6S,6aR)-3,6-bis(1,3-benzodioxol-5-yl)-3,3a,6,6a-tetrahydro-1H-furo[3,4-c]furan-4-one |
SMILES (Canonical) | C1C2C(C(O1)C3=CC4=C(C=C3)OCO4)C(=O)OC2C5=CC6=C(C=C5)OCO6 |
SMILES (Isomeric) | C1[C@H]2[C@@H]([C@H](O1)C3=CC4=C(C=C3)OCO4)C(=O)O[C@@H]2C5=CC6=C(C=C5)OCO6 |
InChI | InChI=1S/C20H16O7/c21-20-17-12(18(27-20)10-1-3-13-15(5-10)25-8-23-13)7-22-19(17)11-2-4-14-16(6-11)26-9-24-14/h1-6,12,17-19H,7-9H2/t12-,17-,18+,19+/m0/s1 |
InChI Key | UIPQDOWYNRWNGN-MDVLYUJXSA-N |
Popularity | 2 references in papers |
Molecular Formula | C20H16O7 |
Molecular Weight | 368.30 g/mol |
Exact Mass | 368.08960285 g/mol |
Topological Polar Surface Area (TPSA) | 72.40 Ų |
XlogP | 2.40 |
(3S,3aS,6S,6aR)-3,6-bis(1,3-benzodioxol-5-yl)-3,3a,6,6a-tetrahydro-1H-furo[3,4-c]furan-4-one |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.25% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.58% | 97.09% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 93.00% | 94.80% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.68% | 95.56% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 91.62% | 96.77% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 91.28% | 93.40% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.21% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.56% | 89.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 84.98% | 91.49% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.77% | 100.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.21% | 92.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.14% | 86.33% |
CHEMBL2039 | P27338 | Monoamine oxidase B | 81.41% | 92.51% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Vitex negundo |
PubChem | 15726240 |
LOTUS | LTS0130017 |
wikiData | Q105273528 |