Aprphine, 1,2-dimethoxy-, (+-)-
Internal ID | fe2b630e-772a-40ad-8607-a91e9b7000c2 |
Taxonomy | Alkaloids and derivatives > Aporphines |
IUPAC Name | (6aS)-1,2-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline |
SMILES (Canonical) | CN1CCC2=CC(=C(C3=C2C1CC4=CC=CC=C43)OC)OC |
SMILES (Isomeric) | CN1CCC2=CC(=C(C3=C2[C@@H]1CC4=CC=CC=C43)OC)OC |
InChI | InChI=1S/C19H21NO2/c1-20-9-8-13-11-16(21-2)19(22-3)18-14-7-5-4-6-12(14)10-15(20)17(13)18/h4-7,11,15H,8-10H2,1-3H3/t15-/m0/s1 |
InChI Key | ORJVQPIHKOARKV-HNNXBMFYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C19H21NO2 |
Molecular Weight | 295.40 g/mol |
Exact Mass | 295.157228913 g/mol |
Topological Polar Surface Area (TPSA) | 21.70 Ų |
XlogP | 3.40 |
dl-Nuciferine |
(+-)-1,2-Dimethoxyaporphine |
1-5, 6-Dimethoxyaporphine |
5868-18-8 |
6a-.beta.-Aporphine, 1,2-dimethoxy- |
CHEMBL4289859 |
DTXSID80207378 |
ORJVQPIHKOARKV-HNNXBMFYSA-N |
4H-Dibenzo(de,g)quinoline, 5,6,6a,7-tetrahydro-1,2-dimethoxy-6-methyl-, (+-)- |
FT-0686669 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.73% | 96.09% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 96.41% | 95.62% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 96.40% | 91.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.29% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 93.73% | 98.95% |
CHEMBL2535 | P11166 | Glucose transporter | 91.12% | 98.75% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.44% | 86.33% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 88.66% | 93.40% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 88.39% | 89.62% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.71% | 97.14% |
CHEMBL5747 | Q92793 | CREB-binding protein | 84.51% | 95.12% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 84.04% | 82.38% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.83% | 91.11% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.98% | 90.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.43% | 95.89% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 82.04% | 96.86% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.44% | 95.89% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 80.84% | 96.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Liriodendron tulipifera |
Monanthotaxis cauliflora |
Nelumbo lutea |
Papaver bracteatum |
PubChem | 22156 |
LOTUS | LTS0250609 |
wikiData | Q83081273 |