Apramide C
| Internal ID | d4446400-b850-4bfd-b68a-3b5f00762422 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
| IUPAC Name | (2S)-N-[(2S)-1-[[(2S)-1-[[(2S)-3-(4-methoxyphenyl)-1-[methyl(1,3-thiazol-2-ylmethyl)amino]-1-oxopropan-2-yl]-methylamino]-3-methyl-1-oxobutan-2-yl]-methylamino]-3-methyl-1-oxobutan-2-yl]-N-methyl-1-[(2S)-3-methyl-2-[methyl-[(2S)-2-[methyl-[(2R)-2-methyloct-7-enoyl]amino]propanoyl]amino]butanoyl]pyrrolidine-2-carboxamide |
| SMILES (Canonical) | CC(C)C(C(=O)N1CCCC1C(=O)N(C)C(C(C)C)C(=O)N(C)C(C(C)C)C(=O)N(C)C(CC2=CC=C(C=C2)OC)C(=O)N(C)CC3=NC=CS3)N(C)C(=O)C(C)N(C)C(=O)C(C)CCCCC=C |
| SMILES (Isomeric) | C[C@H](CCCCC=C)C(=O)N(C)[C@@H](C)C(=O)N(C)[C@@H](C(C)C)C(=O)N1CCC[C@H]1C(=O)N(C)[C@@H](C(C)C)C(=O)N(C)[C@@H](C(C)C)C(=O)N(C)[C@@H](CC2=CC=C(C=C2)OC)C(=O)N(C)CC3=NC=CS3 |
| InChI | InChI=1S/C52H82N8O8S/c1-17-18-19-20-22-36(8)46(61)55(11)37(9)47(62)57(13)45(35(6)7)52(67)60-29-21-23-40(60)49(64)58(14)44(34(4)5)51(66)59(15)43(33(2)3)50(65)56(12)41(31-38-24-26-39(68-16)27-25-38)48(63)54(10)32-42-53-28-30-69-42/h17,24-28,30,33-37,40-41,43-45H,1,18-23,29,31-32H2,2-16H3/t36-,37+,40+,41+,43+,44+,45+/m1/s1 |
| InChI Key | JKGGQCDMVBBAKM-RBFNLMEMSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C52H82N8O8S |
| Molecular Weight | 979.30 g/mol |
| Exact Mass | 978.59763278 g/mol |
| Topological Polar Surface Area (TPSA) | 193.00 Ų |
| XlogP | 7.50 |
| CHEMBL448830 |
| SCHEMBL17583524 |
| DTXSID701335596 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.77% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.03% | 98.95% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 97.77% | 90.24% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 96.28% | 93.10% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.79% | 99.17% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.35% | 90.17% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 94.06% | 98.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 93.64% | 90.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 93.17% | 93.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 92.77% | 95.89% |
| CHEMBL1907599 | P05556 | Integrin alpha-4/beta-1 | 92.74% | 92.86% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 90.99% | 99.18% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.35% | 91.19% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.88% | 96.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.67% | 95.89% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 89.31% | 94.66% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.06% | 95.50% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.91% | 94.45% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 88.83% | 93.81% |
| CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 87.23% | 91.65% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.98% | 94.33% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 86.97% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.71% | 95.56% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.68% | 92.62% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.33% | 90.71% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 83.30% | 95.17% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 83.28% | 100.00% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 81.33% | 96.25% |
| CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 81.16% | 91.43% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.65% | 96.77% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10843605 |
| LOTUS | LTS0234290 |
| wikiData | Q75056960 |