apigenin-4''-O-(2''''-O-p-coumaroyl)-beta-D-glucopyranoside
| Internal ID | 6c67f590-a3fa-43f2-a590-6a5c335be7d4 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides |
| IUPAC Name | [(2R,3S,4R,5R,6S)-2-[4-(5,7-dihydroxy-4-oxochromen-2-yl)phenoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES (Canonical) | C1=CC(=CC=C1C=CC(=O)OC2C(C(C(OC2OC3=CC=C(C=C3)C4=CC(=O)C5=C(C=C(C=C5O4)O)O)CO)O)O)O |
| SMILES (Isomeric) | C1=CC(=CC=C1/C=C/C(=O)O[C@H]2[C@@H]([C@H]([C@@H](O[C@@H]2OC3=CC=C(C=C3)C4=CC(=O)C5=C(C=C(C=C5O4)O)O)CO)O)O)O |
| InChI | InChI=1S/C30H26O12/c31-14-24-27(37)28(38)29(42-25(36)10-3-15-1-6-17(32)7-2-15)30(41-24)39-19-8-4-16(5-9-19)22-13-21(35)26-20(34)11-18(33)12-23(26)40-22/h1-13,24,27-34,37-38H,14H2/b10-3+/t24-,27-,28+,29-,30-/m0/s1 |
| InChI Key | FITSQGVBTPBMCU-CMAQPADGSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C30H26O12 |
| Molecular Weight | 578.50 g/mol |
| Exact Mass | 578.14242626 g/mol |
| Topological Polar Surface Area (TPSA) | 192.00 Ų |
| XlogP | 3.20 |
| BDBM50269378 |
| apigenin-4''-O-(2''''-O-p-coumaroyl)-beta-D-glucopyranoside |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.74% | 91.11% |
| CHEMBL3194 | P02766 | Transthyretin | 98.13% | 90.71% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 98.01% | 89.00% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 95.22% | 98.35% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 94.75% | 86.92% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.65% | 97.09% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 94.54% | 83.57% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.12% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.75% | 98.95% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.31% | 99.15% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.40% | 99.17% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 91.34% | 91.71% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 91.21% | 91.49% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.60% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.36% | 94.45% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.45% | 96.00% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 87.90% | 95.78% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.84% | 94.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.21% | 94.73% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 85.37% | 97.28% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.00% | 90.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.71% | 95.50% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 84.10% | 95.64% |
| CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 83.79% | 88.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.67% | 95.89% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 81.02% | 95.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Palhinhaea cernua |
| PubChem | 44583918 |
| LOTUS | LTS0227832 |
| wikiData | Q104995870 |