Aphidicolin A7
| Internal ID | 15cc41cc-ca8b-4b30-8b12-d1d82913e1de |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Aphidicolane and stemodane diterpenoids |
| IUPAC Name | (1'S,2'S,4R,5'R,6'S,7'R,10'S,12'R)-5'-hydroxy-2,2,2',6'-tetramethylspiro[1,3-dioxolane-4,13'-tetracyclo[10.3.1.01,10.02,7]hexadecane]-6'-carboxylic acid |
| SMILES (Canonical) | CC1(OCC2(O1)CCC34CC2CC3CCC5C4(CCC(C5(C)C(=O)O)O)C)C |
| SMILES (Isomeric) | C[C@]12CC[C@H]([C@@]([C@@H]1CC[C@@H]3[C@@]24CC[C@]5(COC(O5)(C)C)[C@H](C3)C4)(C)C(=O)O)O |
| InChI | InChI=1S/C23H36O5/c1-19(2)27-13-23(28-19)10-9-22-12-15(23)11-14(22)5-6-16-20(22,3)8-7-17(24)21(16,4)18(25)26/h14-17,24H,5-13H2,1-4H3,(H,25,26)/t14-,15+,16+,17+,20-,21-,22-,23-/m0/s1 |
| InChI Key | YTGZFJAGNWIUMT-ZVIFMPMTSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C23H36O5 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.25627424 g/mol |
| Topological Polar Surface Area (TPSA) | 76.00 Ų |
| XlogP | 4.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.66% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.60% | 96.09% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 92.58% | 91.19% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 89.51% | 96.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.48% | 97.09% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 85.89% | 95.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.67% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.10% | 89.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.22% | 100.00% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 82.82% | 95.71% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 82.71% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.45% | 95.56% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 81.15% | 94.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 145721166 |
| LOTUS | LTS0124991 |
| wikiData | Q105361411 |