Antibiotic TAN 1057A
| Internal ID | f2bf75f0-433b-4a4b-b080-2c5c93234876 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
| IUPAC Name | (3S)-3-amino-N-[(5S)-2-(carbamoylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-5-yl]-6-(diaminomethylideneamino)-N-methylhexanamide |
| SMILES (Canonical) | CN(C1CN=C(NC1=O)NC(=O)N)C(=O)CC(CCCN=C(N)N)N |
| SMILES (Isomeric) | CN([C@H]1CN=C(NC1=O)NC(=O)N)C(=O)C[C@H](CCCN=C(N)N)N |
| InChI | InChI=1S/C13H25N9O3/c1-22(8-6-19-13(20-10(8)24)21-12(17)25)9(23)5-7(14)3-2-4-18-11(15)16/h7-8H,2-6,14H2,1H3,(H4,15,16,18)(H4,17,19,20,21,24,25)/t7-,8-/m0/s1 |
| InChI Key | ZMWBCGMRXBPXEU-YUMQZZPRSA-N |
| Popularity | 12 references in papers |
| Molecular Formula | C13H25N9O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.20803569 g/mol |
| Topological Polar Surface Area (TPSA) | 207.00 Ų |
| XlogP | -4.20 |
| TAN-1057A |
| 128126-44-3 |
| 74EKN36H9V |
| (3S)-3-amino-N-[(5S)-2-(carbamoylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-5-yl]-6-(diaminomethylideneamino)-N-methylhexanamide |
| Hexanamide, 3-amino-N-(2-((aminocarbonyl)amino)-1,4,5,6-tetrahydro-4-oxo-5-pyrimidinyl)-6-((aminoiminomethyl)amino)-N-methyl-, (S-(R*,R*))- |
| Tan 1057A |
| UNII-74EKN36H9V |
| SCHEMBL871915 |
| DTXSID20926076 |
| Hexanamide, 3-amino-N-(2-((aminocarbonyl)amino)-1,4,5,6-tetrahydro-4-oxa-5-pyrimidinyl)-6-((aminoiminomethyl)amino)-N-methyl-, (S-(R*,R*))- |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.14% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 96.38% | 83.82% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.31% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.19% | 94.45% |
| CHEMBL204 | P00734 | Thrombin | 94.89% | 96.01% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.79% | 97.09% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 90.87% | 98.59% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.77% | 90.71% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 89.10% | 96.76% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 88.68% | 90.08% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 88.39% | 95.71% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 87.61% | 89.34% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.54% | 98.95% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 84.50% | 82.86% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.44% | 99.17% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 84.20% | 97.50% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 83.92% | 83.10% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.89% | 96.21% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.28% | 94.33% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 83.00% | 98.05% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.61% | 95.89% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.32% | 95.56% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 82.17% | 88.56% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.90% | 98.75% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.85% | 96.90% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.57% | 91.19% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 81.11% | 96.47% |
| CHEMBL2185 | Q96GD4 | Serine/threonine-protein kinase Aurora-B | 80.88% | 96.80% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 3035519 |
| LOTUS | LTS0086118 |
| wikiData | Q77505356 |