Antibiotic K 252a
| Internal ID | 143a7294-a5b2-4f5a-b343-e8e89d1a4951 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles > Pyrrolocarbazoles > Indolocarbazoles |
| IUPAC Name | methyl (15S,16R,18R)-16-hydroxy-15-methyl-3-oxo-28-oxa-4,14,19-triazaoctacyclo[12.11.2.115,18.02,6.07,27.08,13.019,26.020,25]octacosa-1,6,8,10,12,20,22,24,26-nonaene-16-carboxylate |
| SMILES (Canonical) | CC12C(CC(O1)N3C4=CC=CC=C4C5=C6C(=C7C8=CC=CC=C8N2C7=C53)CNC6=O)(C(=O)OC)O |
| SMILES (Isomeric) | C[C@@]12[C@](C[C@@H](O1)N3C4=CC=CC=C4C5=C6C(=C7C8=CC=CC=C8N2C7=C53)CNC6=O)(C(=O)OC)O |
| InChI | InChI=1S/C27H21N3O5/c1-26-27(33,25(32)34-2)11-18(35-26)29-16-9-5-3-7-13(16)20-21-15(12-28-24(21)31)19-14-8-4-6-10-17(14)30(26)23(19)22(20)29/h3-10,18,33H,11-12H2,1-2H3,(H,28,31)/t18-,26+,27+/m1/s1 |
| InChI Key | KOZFSFOOLUUIGY-SOLYNIJKSA-N |
| Popularity | 1,466 references in papers |
| Molecular Formula | C27H21N3O5 |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.14812078 g/mol |
| Topological Polar Surface Area (TPSA) | 94.70 Ų |
| XlogP | 2.80 |
| Atomic LogP (AlogP) | 3.66 |
| H-Bond Acceptor | 7 |
| H-Bond Donor | 2 |
| Rotatable Bonds | 1 |
| 99533-80-9 |
| Antibiotic K 252a |
| K252a |
| Antibiotic SF 2370 |
| SF 2370 |
| K 252a |
| (+)-Antibiotic K 252a |
| IV7H45AM5B |
| CHEMBL281948 |
| CHEBI:43616 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.7604 | 76.04% |
| Caco-2 | - | 0.7445 | 74.45% |
| Blood Brain Barrier | - | 0.6250 | 62.50% |
| Human oral bioavailability | + | 0.5571 | 55.71% |
| Subcellular localzation | Lysosomes | 0.5952 | 59.52% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8990 | 89.90% |
| OATP1B3 inhibitior | + | 0.9350 | 93.50% |
| MATE1 inhibitior | - | 0.9000 | 90.00% |
| OCT2 inhibitior | - | 0.9000 | 90.00% |
| BSEP inhibitior | + | 0.9247 | 92.47% |
| P-glycoprotein inhibitior | + | 0.7173 | 71.73% |
| P-glycoprotein substrate | + | 0.8096 | 80.96% |
| CYP3A4 substrate | + | 0.6885 | 68.85% |
| CYP2C9 substrate | - | 0.8032 | 80.32% |
| CYP2D6 substrate | - | 0.8880 | 88.80% |
| CYP3A4 inhibition | - | 0.7895 | 78.95% |
| CYP2C9 inhibition | - | 0.6549 | 65.49% |
| CYP2C19 inhibition | - | 0.7587 | 75.87% |
| CYP2D6 inhibition | - | 0.9172 | 91.72% |
| CYP1A2 inhibition | - | 0.7127 | 71.27% |
| CYP2C8 inhibition | + | 0.6338 | 63.38% |
| CYP inhibitory promiscuity | - | 0.6632 | 66.32% |
| UGT catelyzed | - | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.8500 | 85.00% |
| Carcinogenicity (trinary) | Non-required | 0.5830 | 58.30% |
| Eye corrosion | - | 0.9896 | 98.96% |
| Eye irritation | - | 0.9672 | 96.72% |
| Skin irritation | - | 0.7924 | 79.24% |
| Skin corrosion | - | 0.9399 | 93.99% |
| Ames mutagenesis | + | 0.5282 | 52.82% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.4704 | 47.04% |
| Micronuclear | + | 0.8000 | 80.00% |
| Hepatotoxicity | + | 0.6947 | 69.47% |
| skin sensitisation | - | 0.8753 | 87.53% |
| Respiratory toxicity | + | 0.8667 | 86.67% |
| Reproductive toxicity | + | 0.9667 | 96.67% |
| Mitochondrial toxicity | + | 0.9125 | 91.25% |
| Nephrotoxicity | - | 0.5987 | 59.87% |
| Acute Oral Toxicity (c) | III | 0.5641 | 56.41% |
| Estrogen receptor binding | + | 0.8131 | 81.31% |
| Androgen receptor binding | + | 0.7112 | 71.12% |
| Thyroid receptor binding | + | 0.6273 | 62.73% |
| Glucocorticoid receptor binding | + | 0.8055 | 80.55% |
| Aromatase binding | + | 0.6766 | 67.66% |
| PPAR gamma | + | 0.6957 | 69.57% |
| Honey bee toxicity | - | 0.7757 | 77.57% |
| Biodegradation | - | 0.9250 | 92.50% |
| Crustacea aquatic toxicity | - | 0.5300 | 53.00% |
| Fish aquatic toxicity | - | 0.4092 | 40.92% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase |
5 nM |
Kd |
via Super-PRED
|
| CHEMBL4045 | Q13131 | AMP-activated protein kinase, alpha-1 subunit |
461 nM |
Kd |
via Super-PRED
|
| CHEMBL2453 | Q9UGJ0 | AMP-activated protein kinase, gamma-2 subunit |
868 nM |
Kd |
via Super-PRED
|
| CHEMBL4522 | Q9NSY1 | BMP-2-inducible protein kinase |
90 nM |
Kd |
via Super-PRED
|
| CHEMBL2276 | P45983 | c-Jun N-terminal kinase 1 |
551 nM |
Kd |
via Super-PRED
|
| CHEMBL4179 | P45984 | c-Jun N-terminal kinase 2 |
986 nM |
Kd |
via Super-PRED
|
| CHEMBL2801 | Q13557 | CaM kinase II delta |
190 nM |
Kd |
via Super-PRED
|
| CHEMBL3829 | Q13555 | CaM kinase II gamma |
173 nM |
Kd |
via Super-PRED
|
| CHEMBL301 | P24941 | Cyclin-dependent kinase 2 |
101 nM |
Kd |
via Super-PRED
|
| CHEMBL331 | P11802 | Cyclin-dependent kinase 4 |
14 nM |
Kd |
via Super-PRED
|
| CHEMBL4036 | Q00535 | Cyclin-dependent kinase 5 |
911 nM |
Kd |
via Super-PRED
|
| CHEMBL2508 | Q00534 | Cyclin-dependent kinase 6 |
399 nM |
Kd |
via Super-PRED
|
| CHEMBL2468 | O43293 | Death-associated protein kinase 3 |
360 nM |
IC50 |
via Super-PRED
|
| CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 |
474 nM |
Kd |
via Super-PRED
|
| CHEMBL2171 | P52564 | Dual specificity mitogen-activated protein kinase kinase 6 |
88 nM |
Kd |
via Super-PRED
|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 |
15 nM |
Kd |
via Super-PRED
|
| CHEMBL3983 | P33981 | Dual specificity protein kinase TTK |
30 nM |
Kd |
via Super-PRED
|
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 |
10 nM |
Kd |
via Super-PRED
|
| CHEMBL3529 | Q14164 | Inhibitor of nuclear factor kappa B kinase epsilon subunit |
494 nM |
Kd |
via Super-PRED
|
| CHEMBL5785 | P19525 | Interferon-induced, double-stranded RNA-activated protein kinase |
100 nM |
IC50 |
via Super-PRED
|
| CHEMBL3778 | Q9NWZ3 | Interleukin-1 receptor-associated kinase 4 |
9 nM |
Kd |
via Super-PRED
|
| CHEMBL3831 | Q7KZI7 | MAP/microtubule affinity-regulating kinase 2 |
704 nM |
Kd |
via Super-PRED
|
| CHEMBL5754 | Q96L34 | MAP/microtubule affinity-regulating kinase 4 |
28 nM |
Kd |
via Super-PRED
|
| CHEMBL4578 | Q14680 | Maternal embryonic leucine zipper kinase |
83 nM |
Kd |
via Super-PRED
|
| CHEMBL2873 | Q02779 | Mitogen-activated protein kinase kinase kinase 10 |
45 nM |
IC50 |
via Super-PRED
|
| CHEMBL2708 | Q16584 | Mitogen-activated protein kinase kinase kinase 11 |
13 nM 572 nM |
IC50 Kd |
via Super-PRED
via Super-PRED |
| CHEMBL5285 | Q99683 | Mitogen-activated protein kinase kinase kinase 5 |
182 nM |
Kd |
via Super-PRED
|
| CHEMBL5749 | Q92918 | Mitogen-activated protein kinase kinase kinase kinase 1 |
452 nM |
Kd |
via Super-PRED
|
| CHEMBL5330 | Q12851 | Mitogen-activated protein kinase kinase kinase kinase 2 |
131 nM |
Kd |
via Super-PRED
|
| CHEMBL6166 | O95819 | Mitogen-activated protein kinase kinase kinase kinase 4 |
19 nM |
Kd |
via Super-PRED
|
| CHEMBL4852 | Q9Y4K4 | Mitogen-activated protein kinase kinase kinase kinase 5 |
193 nM |
Kd |
via Super-PRED
|
| CHEMBL2428 | Q15746 | Myosin light chain kinase, smooth muscle |
17 nM |
Ki |
via Super-PRED
|
| CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A |
1.2 nM 13 nM 2.4 nM |
IC50 IC50 IC50 |
via Super-PRED
via Super-PRED via Super-PRED |
| CHEMBL2595 | O94806 | Protein kinase C nu |
38 nM |
Kd |
via Super-PRED
|
| CHEMBL3384 | Q16512 | Protein kinase N1 |
264 nM |
Kd |
via Super-PRED
|
| CHEMBL3032 | Q16513 | Protein kinase N2 |
361 nM |
Kd |
via Super-PRED
|
| CHEMBL5331 | Q12866 | Proto-oncogene tyrosine-protein kinase MER |
41 nM |
Kd |
via Super-PRED
|
| CHEMBL3125 | O75676 | Ribosomal protein S6 kinase alpha 4 |
432 nM |
Kd |
via Super-PRED
|
| CHEMBL3981 | O94804 | Serine/threonine-protein kinase 10 |
481 nM |
Kd |
via Super-PRED
|
| CHEMBL4722 | O14965 | Serine/threonine-protein kinase Aurora-A |
20 nM |
Kd |
via Super-PRED
|
| CHEMBL2185 | Q96GD4 | Serine/threonine-protein kinase Aurora-B |
353 nM |
Kd |
via Super-PRED
|
| CHEMBL5600 | P27448 | Serine/threonine-protein kinase c-TAK1 |
384 nM |
Kd |
via Super-PRED
|
| CHEMBL4630 | O14757 | Serine/threonine-protein kinase Chk1 |
122 nM |
Kd |
via Super-PRED
|
| CHEMBL4900 | Q9BZL6 | Serine/threonine-protein kinase D2 |
30 nM |
Kd |
via Super-PRED
|
| CHEMBL6167 | O95835 | Serine/threonine-protein kinase LATS1 |
67 nM |
Kd |
via Super-PRED
|
| CHEMBL4598 | Q13043 | Serine/threonine-protein kinase MST1 |
29 nM |
Kd |
via Super-PRED
|
| CHEMBL4708 | Q13188 | Serine/threonine-protein kinase MST2 |
43 nM |
Kd |
via Super-PRED
|
| CHEMBL4482 | O96013 | Serine/threonine-protein kinase PAK 4 |
344 nM |
Kd |
via Super-PRED
|
| CHEMBL3788 | O00444 | Serine/threonine-protein kinase PLK4 |
73 nM |
Kd |
via Super-PRED
|
| CHEMBL5014 | O43353 | Serine/threonine-protein kinase RIPK2 |
526 nM |
Kd |
via Super-PRED
|
| CHEMBL5699 | Q9H0K1 | Serine/threonine-protein kinase SIK2 |
58 nM |
Kd |
via Super-PRED
|
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 |
19 nM |
Kd |
via Super-PRED
|
| CHEMBL4527 | Q9UKE5 | TRAF2- and NCK-interacting kinase |
10 nM |
Kd |
via Super-PRED
|
| CHEMBL3982 | P16591 | Tyrosine-protein kinase FER |
455 nM |
Kd |
via Super-PRED
|
| CHEMBL1974 | P36888 | Tyrosine-protein kinase receptor FLT3 |
227 nM |
Kd |
via Super-PRED
|
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET |
669 nM |
Kd |
via Super-PRED
|
| CHEMBL2599 | P43405 | Tyrosine-protein kinase SYK |
545 nM |
Kd |
via Super-PRED
|
| CHEMBL4105933 | Q6ZSR9 | Uncharacterized protein FLJ45252 |
21 nM |
Kd |
via Super-PRED
|
| CHEMBL279 | P35968 | Vascular endothelial growth factor receptor 2 |
43 nM 19 nM 43 nM |
IC50 IC50 IC50 |
via Super-PRED
via Super-PRED via Super-PRED |
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.78% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.52% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.81% | 96.09% |
| CHEMBL4924 | Q9UK32 | Ribosomal protein S6 kinase alpha 6 | 96.05% | 80.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.52% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.95% | 89.00% |
| CHEMBL5408 | Q9UHD2 | Serine/threonine-protein kinase TBK1 | 94.26% | 90.48% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.92% | 98.95% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 92.61% | 93.03% |
| CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 92.40% | 89.23% |
| CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 91.85% | 90.95% |
| CHEMBL4599 | Q07912 | Tyrosine kinase non-receptor protein 2 | 91.28% | 94.29% |
| CHEMBL4355 | O14976 | Serine/threonine-protein kinase GAK | 91.04% | 89.32% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 90.38% | 85.11% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 90.23% | 96.47% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.87% | 99.23% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.75% | 93.99% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 88.49% | 98.59% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.00% | 94.00% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 87.27% | 95.83% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 86.93% | 96.00% |
| CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 86.76% | 88.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.45% | 95.89% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.44% | 86.33% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.83% | 97.14% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.33% | 91.07% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 83.93% | 90.08% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 83.82% | 98.03% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 83.79% | 92.67% |
| CHEMBL5314 | Q06418 | Tyrosine-protein kinase receptor TYRO3 | 82.29% | 96.00% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 82.24% | 95.64% |
| CHEMBL1936 | P10721 | Stem cell growth factor receptor | 82.03% | 84.17% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.80% | 90.00% |
| CHEMBL3820 | P35557 | Hexokinase type IV | 80.99% | 91.96% |
| CHEMBL2803 | P43403 | Tyrosine-protein kinase ZAP-70 | 80.65% | 82.50% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.36% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 3035817 |
| LOTUS | LTS0265204 |
| wikiData | Q5931064 |