Antanapeptin D
| Internal ID | 1adcfb8c-e16a-4848-a29d-457dec7f18d3 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | (3S,6S,9S,16S,19S)-6-benzyl-7,12,17-trimethyl-13-pent-4-ynyl-3,9,16-tri(propan-2-yl)-4,14-dioxa-1,7,10,17-tetrazabicyclo[17.3.0]docosane-2,5,8,11,15,18-hexone |
| SMILES (Canonical) | CC1C(OC(=O)C(N(C(=O)C2CCCN2C(=O)C(OC(=O)C(N(C(=O)C(NC1=O)C(C)C)C)CC3=CC=CC=C3)C(C)C)C)C(C)C)CCCC#C |
| SMILES (Isomeric) | CC1C(OC(=O)[C@@H](N(C(=O)[C@@H]2CCCN2C(=O)[C@@H](OC(=O)[C@@H](N(C(=O)[C@@H](NC1=O)C(C)C)C)CC3=CC=CC=C3)C(C)C)C)C(C)C)CCCC#C |
| InChI | InChI=1S/C40H58N4O8/c1-11-12-14-21-31-27(8)35(45)41-32(24(2)3)37(47)42(9)30(23-28-18-15-13-16-19-28)39(49)52-34(26(6)7)38(48)44-22-17-20-29(44)36(46)43(10)33(25(4)5)40(50)51-31/h1,13,15-16,18-19,24-27,29-34H,12,14,17,20-23H2,2-10H3,(H,41,45)/t27?,29-,30-,31?,32-,33-,34-/m0/s1 |
| InChI Key | HGDNKULJQQBFCT-DQNVORKUSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C40H58N4O8 |
| Molecular Weight | 722.90 g/mol |
| Exact Mass | 722.42546482 g/mol |
| Topological Polar Surface Area (TPSA) | 143.00 Ų |
| XlogP | 6.20 |
| (3S,6S,9S,16S,19S)-6-benzyl-7,12,17-trimethyl-13-pent-4-ynyl-3,9,16-tri(propan-2-yl)-4,14-dioxa-1,7,10,17-tetrazabicyclo[17.3.0]docosane-2,5,8,11,15,18-hexone |
| (3S,6S,9S,16S,19S)-6-benzyl-7,12,17-trimethyl-13-pent-4-ynyl-3,9,16-tri(propan-2-yl)-4,14-dioxa-1,7,10,17-tetrazabicyclo(17.3.0)docosane-2,5,8,11,15,18-hexone |
| RefChem:112945 |
| 400604-09-3 |
| SCHEMBL4263375 |
| CHEBI:200997 |
| DTXSID601335181 |
| (3S,10S,13S,16S,21aS)-13-Benzyl-2,7,12-trimethyl-6-(pent-4-yn-1-yl)-3,10,16-tri(propan-2-yl)decahydro-6H-pyrrolo[2,1-f][1,10,4,7,13,16]dioxatetraazacyclononadecine-1,4,8,11,14,17(7H,16H)-hexone |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.87% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.87% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.44% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.47% | 95.56% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 96.37% | 90.08% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 96.33% | 91.76% |
| CHEMBL4072 | P07858 | Cathepsin B | 95.01% | 93.67% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 93.13% | 82.38% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 92.34% | 96.31% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.72% | 97.25% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 91.65% | 97.64% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 90.62% | 97.05% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 89.62% | 99.18% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.50% | 95.89% |
| CHEMBL3837 | P07711 | Cathepsin L | 87.66% | 96.61% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 87.33% | 93.00% |
| CHEMBL228 | P31645 | Serotonin transporter | 86.89% | 95.51% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 86.83% | 91.49% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.76% | 90.71% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 86.20% | 93.03% |
| CHEMBL3227 | P41594 | Metabotropic glutamate receptor 5 | 85.59% | 96.42% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.43% | 90.17% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 85.30% | 92.97% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.80% | 86.33% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 83.02% | 98.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.95% | 99.23% |
| CHEMBL1949 | P62937 | Cyclophilin A | 81.45% | 98.57% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10865453 |
| LOTUS | LTS0132572 |
| wikiData | Q77280876 |