Anserine
| Internal ID | 3ab8723c-3b0f-439a-9da5-96f3a3f830b8 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
| IUPAC Name | (2S)-2-(3-aminopropanoylamino)-3-(3-methylimidazol-4-yl)propanoic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C10H16N4O3/c1-14-6-12-5-7(14)4-8(10(16)17)13-9(15)2-3-11/h5-6,8H,2-4,11H2,1H3,(H,13,15)(H,16,17)/t8-/m0/s1 |
| InChI Key | MYYIAHXIVFADCU-QMMMGPOBSA-N |
| Popularity | 2,026 references in papers |
| Molecular Formula | C10H16N4O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.12224039 g/mol |
| Topological Polar Surface Area (TPSA) | 110.00 Ų |
| XlogP | -4.00 |
| ANSERINE |
| 584-85-0 |
| beta-alanyl-3-methyl-L-histidine |
| HDQ4N37UGV |
| DTXSID30973950 |
| (2S)-2-(3-aminopropanoylamino)-3-(3-methylimidazol-4-yl)propanoic acid |
| L-Histidine, N-beta-alanyl-3-methyl- |
| CHEBI:18323 |
| (2S)-2-(3-aminopropanamido)-3-(1-methyl-1H-imidazol-5-yl)propanoic acid |
| Balanine |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 97.90% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.38% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.89% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.01% | 99.17% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.00% | 90.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.54% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.95% | 95.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.69% | 96.00% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 84.53% | 92.29% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 82.87% | 98.33% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 82.85% | 100.00% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 82.10% | 95.17% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 81.76% | 90.20% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 80.77% | 90.24% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.17% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 112072 |
| LOTUS | LTS0062440 |
| wikiData | Q415335 |