Annomuricin C
Internal ID | fbc841c0-d6ca-4c8a-a617-250906fac1a9 |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohols > Annonaceous acetogenins |
IUPAC Name | (2S)-2-methyl-4-[(2R,8S,9S,13R)-2,8,9,13-tetrahydroxy-13-[(2R,5R)-5-[(1R)-1-hydroxytridecyl]oxolan-2-yl]tridecyl]-2H-furan-5-one |
SMILES (Canonical) | CCCCCCCCCCCCC(C1CCC(O1)C(CCCC(C(CCCCCC(CC2=CC(OC2=O)C)O)O)O)O)O |
SMILES (Isomeric) | CCCCCCCCCCCC[C@H]([C@H]1CC[C@@H](O1)[C@@H](CCC[C@@H]([C@H](CCCCC[C@H](CC2=C[C@@H](OC2=O)C)O)O)O)O)O |
InChI | InChI=1S/C35H64O8/c1-3-4-5-6-7-8-9-10-11-14-19-31(39)33-22-23-34(43-33)32(40)21-16-20-30(38)29(37)18-15-12-13-17-28(36)25-27-24-26(2)42-35(27)41/h24,26,28-34,36-40H,3-23,25H2,1-2H3/t26-,28+,29-,30-,31+,32+,33+,34+/m0/s1 |
InChI Key | LPDLLEWSLYZCOC-IYRMFVFKSA-N |
Popularity | 3 references in papers |
Molecular Formula | C35H64O8 |
Molecular Weight | 612.90 g/mol |
Exact Mass | 612.46011900 g/mol |
Topological Polar Surface Area (TPSA) | 137.00 Ų |
XlogP | 7.40 |
CHEMBL504774 |
(2S)-2-methyl-4-[(2R,8S,9S,13R)-2,8,9,13-tetrahydroxy-13-[(2R,5R)-5-[(1R)-1-hydroxytridecyl]oxolan-2-yl]tridecyl]-2H-furan-5-one |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 97.97% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.11% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.76% | 97.25% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.71% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.55% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.32% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.56% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.34% | 97.09% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 86.64% | 92.88% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.92% | 93.56% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 84.66% | 92.08% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.65% | 86.33% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.48% | 90.71% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.04% | 100.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.19% | 99.23% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.16% | 100.00% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 82.05% | 92.86% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 81.95% | 85.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Annona muricata |
PubChem | 11758463 |
LOTUS | LTS0121733 |
wikiData | Q105155106 |