Aniquinazoline C
| Internal ID | 32c10c70-09ec-4861-ae21-4ad76ad889bf |
| Taxonomy | Organoheterocyclic compounds > Azolidines > Imidazolidines > Phenylimidazolidines |
| IUPAC Name | (1S,4R)-1-hydroxy-4-[2-hydroxy-2-[(2R,4S)-5-oxo-1-phenyl-4-propan-2-ylimidazolidin-2-yl]propyl]-1-methyl-2,4-dihydropyrazino[2,1-b]quinazoline-3,6-dione |
| SMILES (Canonical) | CC(C)C1C(=O)N(C(N1)C(C)(CC2C(=O)NC(C3=NC4=CC=CC=C4C(=O)N23)(C)O)O)C5=CC=CC=C5 |
| SMILES (Isomeric) | CC(C)[C@H]1C(=O)N([C@@H](N1)C(C)(C[C@@H]2C(=O)N[C@@](C3=NC4=CC=CC=C4C(=O)N23)(C)O)O)C5=CC=CC=C5 |
| InChI | InChI=1S/C27H31N5O5/c1-15(2)20-23(35)31(16-10-6-5-7-11-16)24(29-20)26(3,36)14-19-21(33)30-27(4,37)25-28-18-13-9-8-12-17(18)22(34)32(19)25/h5-13,15,19-20,24,29,36-37H,14H2,1-4H3,(H,30,33)/t19-,20+,24-,26?,27+/m1/s1 |
| InChI Key | ALKYEXCSBFPRPV-ALXWUKCCSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C27H31N5O5 |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.23251911 g/mol |
| Topological Polar Surface Area (TPSA) | 135.00 Ų |
| XlogP | 1.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.51% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.97% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.39% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.43% | 86.33% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 91.66% | 94.75% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.38% | 99.23% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.85% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.11% | 95.56% |
| CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 86.53% | 95.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.14% | 94.00% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 86.06% | 94.62% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 85.39% | 100.00% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 82.53% | 90.08% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 82.47% | 96.67% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.64% | 93.56% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 80.52% | 97.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139587840 |
| LOTUS | LTS0129052 |
| wikiData | Q77625133 |