Anhydrotuberosin
Internal ID | 3f6b9aab-4905-48ff-8d81-4595e8418327 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Furanoisoflavonoids > Pterocarpans |
IUPAC Name | 7,7-dimethyl-8,12,20-trioxapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2(11),3,5,9,14(19),15,17-octaen-17-ol |
SMILES (Canonical) | CC1(C=CC2=CC3=C(C=C2O1)OC4=C3COC5=C4C=CC(=C5)O)C |
SMILES (Isomeric) | CC1(C=CC2=CC3=C(C=C2O1)OC4=C3COC5=C4C=CC(=C5)O)C |
InChI | InChI=1S/C20H16O4/c1-20(2)6-5-11-7-14-15-10-22-17-8-12(21)3-4-13(17)19(15)23-18(14)9-16(11)24-20/h3-9,21H,10H2,1-2H3 |
InChI Key | JKBQWLWECJXFBS-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H16O4 |
Molecular Weight | 320.30 g/mol |
Exact Mass | 320.10485899 g/mol |
Topological Polar Surface Area (TPSA) | 51.80 Ų |
XlogP | 4.10 |
41347-49-3 |
7,7-dimethyl-8,12,20-trioxapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2(11),3,5,9,14(19),15,17-octaen-17-ol |
3-Hydroxy-6'',6''-dimethylpyrano[2'',3'':9,8]pterocarpene |
6H,10H-Furo[3,2-c:4,5-g']bis[1]benzopyran-3-ol, 10,10-dimethyl-; 10,10-Dimethyl-6H,10H-pyrano[3',2':5,6]benzofuro[3,2-c][1]benzopyran-3-ol; 6a,11a-Dehydrotuberosin |
starbld0000837 |
LMPK12070147 |
AKOS032961789 |
FS-9875 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.17% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.59% | 91.49% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 97.65% | 98.35% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.19% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 93.18% | 98.95% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.89% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.32% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.82% | 97.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.03% | 92.94% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.53% | 90.00% |
CHEMBL2535 | P11166 | Glucose transporter | 84.57% | 98.75% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.73% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.66% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.36% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.29% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Pueraria tuberosa |
PubChem | 21676230 |
LOTUS | LTS0259235 |
wikiData | Q104398004 |