Anhydroplatynecine
| Internal ID | bba8f585-a22c-432c-8476-898c3e6ef672 |
| Taxonomy | Organoheterocyclic compounds > Pyrrolizidines |
| IUPAC Name | (1R)-7-methylidene-1,2,3,5,6,8-hexahydropyrrolizin-1-ol |
| SMILES (Canonical) | C=C1CCN2C1C(CC2)O |
| SMILES (Isomeric) | C=C1CCN2C1[C@@H](CC2)O |
| InChI | InChI=1S/C8H13NO/c1-6-2-4-9-5-3-7(10)8(6)9/h7-8,10H,1-5H2/t7-,8?/m1/s1 |
| InChI Key | OVTJHGIWYOOHFS-GVHYBUMESA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.19 g/mol |
| Exact Mass | 139.099714038 g/mol |
| Topological Polar Surface Area (TPSA) | 23.50 Ų |
| XlogP | 0.10 |
| OVTJHGIWYOOHFS-GVHYBUMESA-N |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 84.77% | 98.46% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.18% | 96.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.11% | 95.89% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.35% | 91.11% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.95% | 92.94% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 80.52% | 96.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Senecio hydrophilus |
| PubChem | 91749888 |
| LOTUS | LTS0167998 |
| wikiData | Q104375996 |