1-(9-Azabicyclo(4.2.1)non-2-en-2-yl)ethanone
| Internal ID | 6d3e94f3-d09e-484a-a1c3-850dc05e903d |
| Taxonomy | Alkaloids and derivatives > Anatoxins |
| IUPAC Name | 1-(9-azabicyclo[4.2.1]non-2-en-2-yl)ethanone |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C10H15NO/c1-7(12)9-4-2-3-8-5-6-10(9)11-8/h4,8,10-11H,2-3,5-6H2,1H3 |
| InChI Key | SGNXVBOIDPPRJJ-UHFFFAOYSA-N |
| Popularity | 152 references in papers |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.23 g/mol |
| Exact Mass | 165.115364102 g/mol |
| Topological Polar Surface Area (TPSA) | 29.10 Ų |
| XlogP | 0.80 |
| 85514-42-7 |
| DTXSID301338831 |
| 1-(9-azabicyclo(4.2.1)non-2-en-2-yl)ethanone |
| RefChem:1054570 |
| DTXCID60815278 |
| CHEMBL25619 |
| 2-acetyl-9-azabicyclo[4.2.1]non-2-ene |
| AC1L8S0X |
| (+)-Anatoxin |
| Anatoxin-A,(+) |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit |
91 nM |
Ki |
via Super-PRED
|
| CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 |
0.34 nM |
Ki |
via Super-PRED
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.50% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.70% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.72% | 97.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.12% | 97.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.21% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.22% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.76% | 98.95% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.31% | 100.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.30% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 431734 |
| LOTUS | LTS0176948 |
| wikiData | Q3303006 |