Anatolioside B
| Internal ID | a7684ac6-bc91-4a43-9555-638488f5b4cd |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acyl glycosides > Fatty acyl glycosides of mono- and disaccharides |
| IUPAC Name | [6-[2-[(3R)-3,7-dimethylocta-1,6-dien-3-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]oxy-4,5-dihydroxy-2-methyloxan-3-yl] (2E,6R)-2,6-dimethyl-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyocta-2,7-dienoate |
| SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(C(OC2OC(C)(CCC=C(C)C)C=C)CO)O)O)O)O)OC(=O)C(=CCCC(C)(C=C)OC3C(C(C(C(O3)CO)O)O)O)C |
| SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(C(C(OC2O[C@](C)(CCC=C(C)C)C=C)CO)O)O)O)O)OC(=O)/C(=C/CC[C@](C)(C=C)OC3C(C(C(C(O3)CO)O)O)O)/C |
| InChI | InChI=1S/C38H62O17/c1-9-37(7,54-35-29(46)26(43)24(41)22(17-39)50-35)16-12-14-20(5)33(48)52-31-21(6)49-34(30(47)28(31)45)53-32-27(44)25(42)23(18-40)51-36(32)55-38(8,10-2)15-11-13-19(3)4/h9-10,13-14,21-32,34-36,39-47H,1-2,11-12,15-18H2,3-8H3/b20-14+/t21?,22?,23?,24?,25?,26?,27?,28?,29?,30?,31?,32?,34?,35?,36?,37-,38-/m0/s1 |
| InChI Key | APAHNYYFTCHLNN-YMXDPOEISA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C38H62O17 |
| Molecular Weight | 790.90 g/mol |
| Exact Mass | 790.39870051 g/mol |
| Topological Polar Surface Area (TPSA) | 264.00 Ų |
| XlogP | 0.70 |
| NSC671299 |
| NSC-671299 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.88% | 91.11% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 93.84% | 97.36% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 92.01% | 94.73% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.46% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.46% | 99.17% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.10% | 97.25% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.15% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.82% | 96.09% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 87.11% | 91.24% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 85.18% | 98.75% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.10% | 96.47% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.13% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Viburnum orientale |
| PubChem | 5352067 |
| LOTUS | LTS0083488 |
| wikiData | Q104916130 |