Anabasamine
Internal ID | 1750f7fe-b293-4720-b0f0-48325a444bdd |
Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Bipyridines and oligopyridines |
IUPAC Name | 5-(1-methylpiperidin-2-yl)-2-pyridin-3-ylpyridine |
SMILES (Canonical) | CN1CCCCC1C2=CN=C(C=C2)C3=CN=CC=C3 |
SMILES (Isomeric) | CN1CCCCC1C2=CN=C(C=C2)C3=CN=CC=C3 |
InChI | InChI=1S/C16H19N3/c1-19-10-3-2-6-16(19)14-7-8-15(18-12-14)13-5-4-9-17-11-13/h4-5,7-9,11-12,16H,2-3,6,10H2,1H3 |
InChI Key | TZRDBHMKTWECOV-UHFFFAOYSA-N |
Popularity | 26 references in papers |
Molecular Formula | C16H19N3 |
Molecular Weight | 253.34 g/mol |
Exact Mass | 253.157897619 g/mol |
Topological Polar Surface Area (TPSA) | 29.00 Ų |
XlogP | 1.60 |
RAC-ANABASAMINE |
20410-87-1 |
400738-05-8 |
Anabasamine, (+)- |
5-(1-methylpiperidin-2-yl)-2-pyridin-3-ylpyridine |
(+)-5-(1-Methyl-2-piperidinyl)-2,3'-bipyridine |
65LB65490V |
2,3'-Bipyridine, 5-(1-methyl-2-piperidinyl)-, (+)- |
5-(1-methyl-2-piperidyl)-2-(3-pyridyl)pyridine |
2,3'-Bipyridine, 5-(1-methyl-2-piperidinyl)-, (+)- (9CI) |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.00% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 96.83% | 98.95% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 93.45% | 99.18% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 90.97% | 96.00% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 90.44% | 97.53% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 87.01% | 93.65% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 86.48% | 98.33% |
CHEMBL1075145 | P55072 | Transitional endoplasmic reticulum ATPase | 85.88% | 98.50% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.87% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.63% | 95.89% |
CHEMBL1938212 | Q9UPP1 | Histone lysine demethylase PHF8 | 84.07% | 98.33% |
CHEMBL1741221 | Q9Y4P1 | Cysteine protease ATG4B | 83.97% | 87.50% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.44% | 97.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.09% | 94.00% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.94% | 100.00% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.13% | 93.40% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.71% | 90.71% |
CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 81.58% | 96.47% |
CHEMBL2094121 | P14867 | GABA-A receptor; alpha-1/beta-3/gamma-2 | 80.72% | 95.50% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 80.67% | 93.10% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.62% | 99.23% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 80.44% | 91.49% |
CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 80.32% | 98.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Anabasis aphylla |
PubChem | 161313 |
LOTUS | LTS0068133 |
wikiData | Q27165594 |