Amurensine
Internal ID | 6fe31ca2-db77-4793-8012-67d198b557ba |
Taxonomy | Benzenoids > Dibenzocycloheptenes |
IUPAC Name | (1S,11R)-15-methoxy-19-methyl-5,7-dioxa-19-azapentacyclo[9.7.2.02,10.04,8.012,17]icosa-2,4(8),9,12,14,16-hexaen-14-ol |
SMILES (Canonical) | CN1CC2C3=CC(=C(C=C3CC1C4=CC5=C(C=C24)OCO5)OC)O |
SMILES (Isomeric) | CN1C[C@@H]2C3=CC(=C(C=C3C[C@H]1C4=CC5=C(C=C24)OCO5)OC)O |
InChI | InChI=1S/C19H19NO4/c1-20-8-14-11-5-16(21)17(22-2)4-10(11)3-15(20)13-7-19-18(6-12(13)14)23-9-24-19/h4-7,14-15,21H,3,8-9H2,1-2H3/t14-,15+/m1/s1 |
InChI Key | BXWVSGUITWLTOD-CABCVRRESA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H19NO4 |
Molecular Weight | 325.40 g/mol |
Exact Mass | 325.13140809 g/mol |
Topological Polar Surface Area (TPSA) | 51.20 Ų |
XlogP | 2.70 |
10481-92-2 |
C09333 |
CHEBI:2688 |
DTXSID70331757 |
Q4748992 |
(1S,11R)-15-methoxy-19-methyl-5,7-dioxa-19-azapentacyclo[9.7.2.02,10.04,8.012,17]icosa-2,4(8),9,12,14,16-hexaen-14-ol |
![2D Structure of Amurensine 2D Structure of Amurensine](https://plantaedb.com/storage/docs/compounds/2023/11/amurensine.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.51% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.36% | 85.14% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 96.11% | 96.77% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.65% | 91.11% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 94.47% | 93.40% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.64% | 89.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.71% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 89.42% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.52% | 94.45% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.30% | 92.62% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 86.09% | 91.00% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 85.42% | 88.48% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 85.28% | 82.67% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.62% | 95.89% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.92% | 95.89% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 83.78% | 95.62% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.53% | 99.17% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 83.40% | 82.38% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.33% | 86.33% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 83.19% | 93.99% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 82.78% | 89.50% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 82.28% | 96.86% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.61% | 92.94% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.38% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Papaver pygmaeum |
PubChem | 442164 |
LOTUS | LTS0069148 |
wikiData | Q4748992 |