Aminoansamycin C
| Internal ID | 5c98d163-62e7-4c1c-ae6a-1671adf05a8c |
| Taxonomy | Benzenoids > Phenols > 1-hydroxy-2-unsubstituted benzenoids |
| IUPAC Name | (4R,5R,6E,8E,11R)-5,14,16-trihydroxy-11-methoxy-4-methyl-2-azabicyclo[10.3.1]hexadeca-1(15),6,8,12(16),13-pentaen-3-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C17H21NO5/c1-10-14(20)6-4-3-5-7-15(23-2)12-8-11(19)9-13(16(12)21)18-17(10)22/h3-6,8-10,14-15,19-21H,7H2,1-2H3,(H,18,22)/b5-3+,6-4+/t10-,14-,15-/m1/s1 |
| InChI Key | JTULUOQLOISFLX-IQTPZEKISA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.14197277 g/mol |
| Topological Polar Surface Area (TPSA) | 99.00 Ų |
| XlogP | 1.40 |
| (4R,5R,6E,8E,11R)-5,14,16-trihydroxy-11-methoxy-4-methyl-2-azabicyclo[10.3.1]hexadeca-1(15),6,8,12(16),13-pentaen-3-one |
| (4R,5R,6E,8E,11R)-5,14,16-trihydroxy-11-methoxy-4-methyl-2-azabicyclo(10.3.1)hexadeca-1(15),6,8,12(16),13-pentaen-3-one |
| RefChem:112004 |
| CHEBI:210065 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.08% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.08% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.53% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.04% | 94.45% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 94.44% | 93.40% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.46% | 95.56% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.08% | 92.94% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.93% | 94.75% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.26% | 97.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.13% | 90.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.11% | 94.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.94% | 85.14% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.63% | 99.15% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.52% | 95.89% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.78% | 91.07% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.57% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.26% | 98.75% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.50% | 97.25% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.31% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146683253 |
| LOTUS | LTS0063472 |
| wikiData | Q105135010 |