Alterporriol P
| Internal ID | bb194ae5-d9b1-4d81-abec-d2b8e6b7aead |
| Taxonomy | Benzenoids > Anthracenes > Anthraquinones > Hydroxyanthraquinones |
| IUPAC Name | 2,8-dihydroxy-6-methoxy-3-methyl-1-[(5R,6R,7R)-1,5,6,7-tetrahydroxy-3-methoxy-6-methyl-9,10-dioxo-7,8-dihydro-5H-anthracen-2-yl]anthracene-9,10-dione |
| SMILES (Canonical) | CC1=CC2=C(C(=C1O)C3=C(C=C4C(=C3O)C(=O)C5=C(C4=O)C(C(C(C5)O)(C)O)O)OC)C(=O)C6=C(C2=O)C=C(C=C6O)OC |
| SMILES (Isomeric) | CC1=CC2=C(C(=C1O)C3=C(C=C4C(=C3O)C(=O)C5=C(C4=O)[C@H]([C@]([C@@H](C5)O)(C)O)O)OC)C(=O)C6=C(C2=O)C=C(C=C6O)OC |
| InChI | InChI=1S/C32H26O12/c1-10-5-12-20(29(39)19-13(26(12)36)6-11(43-3)7-16(19)33)24(25(10)35)23-17(44-4)8-14-21(30(23)40)27(37)15-9-18(34)32(2,42)31(41)22(15)28(14)38/h5-8,18,31,33-35,40-42H,9H2,1-4H3/t18-,31-,32-/m1/s1 |
| InChI Key | CKIZCIRWASRCGD-YSMSDFMNSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C32H26O12 |
| Molecular Weight | 602.50 g/mol |
| Exact Mass | 602.14242626 g/mol |
| Topological Polar Surface Area (TPSA) | 208.00 Ų |
| XlogP | 2.50 |
| CHEMBL2011667 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.78% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.37% | 95.56% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 96.50% | 99.15% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.86% | 98.95% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 92.79% | 96.21% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.73% | 99.23% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 92.25% | 90.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.24% | 94.00% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 92.23% | 92.68% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.82% | 89.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.34% | 95.89% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.53% | 96.09% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 88.52% | 96.38% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.18% | 98.75% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.07% | 92.94% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.76% | 85.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.74% | 94.45% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 87.23% | 91.49% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.15% | 86.33% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 86.46% | 91.07% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.16% | 94.75% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.57% | 93.03% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.98% | 97.14% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 80.85% | 91.00% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 80.84% | 96.67% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.47% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 57332380 |
| LOTUS | LTS0219072 |
| wikiData | Q77385331 |