Alterochromide B'
| Internal ID | d49a40e7-5196-4cb2-973a-08851515c10d |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | (2E,4E,6E,8E,10E)-N-[(3S,6S,9S,12S,15S,16R)-6,9-bis(2-amino-2-oxoethyl)-16-methyl-3-(2-methylpropyl)-2,5,8,11,14-pentaoxo-12-propan-2-yl-1-oxa-4,7,10,13-tetrazacyclohexadec-15-yl]-11-(4-hydroxyphenyl)undeca-2,4,6,8,10-pentaenamide |
| SMILES (Canonical) | CC1C(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)O1)CC(C)C)CC(=O)N)CC(=O)N)C(C)C)NC(=O)C=CC=CC=CC=CC=CC2=CC=C(C=C2)O |
| SMILES (Isomeric) | C[C@@H]1[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O1)CC(C)C)CC(=O)N)CC(=O)N)C(C)C)NC(=O)/C=C/C=C/C=C/C=C/C=C/C2=CC=C(C=C2)O |
| InChI | InChI=1S/C40H53N7O10/c1-23(2)20-30-40(56)57-25(5)35(46-33(51)15-13-11-9-7-6-8-10-12-14-26-16-18-27(48)19-17-26)39(55)47-34(24(3)4)38(54)44-29(22-32(42)50)36(52)43-28(21-31(41)49)37(53)45-30/h6-19,23-25,28-30,34-35,48H,20-22H2,1-5H3,(H2,41,49)(H2,42,50)(H,43,52)(H,44,54)(H,45,53)(H,46,51)(H,47,55)/b7-6+,10-8+,11-9+,14-12+,15-13+/t25-,28+,29+,30+,34+,35+/m1/s1 |
| InChI Key | QXFREDMSNUKBFB-ZRODPMGZSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C40H53N7O10 |
| Molecular Weight | 791.90 g/mol |
| Exact Mass | 791.38539091 g/mol |
| Topological Polar Surface Area (TPSA) | 278.00 Ų |
| XlogP | 2.20 |
| CHEBI:218592 |
| (2E,4E,6E,8E,10E)-N-[(3S,6S,9S,12S,15S,16R)-6,9-bis(2-amino-2-oxoethyl)-16-methyl-3-(2-methylpropyl)-2,5,8,11,14-pentaoxo-12-propan-2-yl-1-oxa-4,7,10,13-tetrazacyclohexadec-15-yl]-11-(4-hydroxyphenyl)undeca-2,4,6,8,10-pentaenamide |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.69% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.06% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.90% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.91% | 95.56% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 90.38% | 83.10% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.03% | 96.47% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 89.32% | 83.82% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.98% | 89.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.76% | 97.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.43% | 99.17% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 87.45% | 90.93% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.04% | 90.71% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 85.44% | 85.00% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 85.19% | 95.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.12% | 94.73% |
| CHEMBL1949 | P62937 | Cyclophilin A | 84.62% | 98.57% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.26% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.62% | 94.45% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 81.61% | 94.80% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 80.87% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139588684 |
| LOTUS | LTS0123493 |
| wikiData | Q105229585 |