(alphaS)-alpha-Amino-6-carboxy-1,2-dihydro-2-oxo-4-pyridinepropanoic acid
| Internal ID | bcf0b7b0-d98a-424b-87f5-33140edd9368 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Alpha amino acids |
| IUPAC Name | 4-[(2S)-2-amino-2-carboxyethyl]-6-oxo-1H-pyridine-2-carboxylic acid |
| SMILES (Canonical) | C1=C(C=C(NC1=O)C(=O)O)CC(C(=O)O)N |
| SMILES (Isomeric) | C1=C(C=C(NC1=O)C(=O)O)C[C@@H](C(=O)O)N |
| InChI | InChI=1S/C9H10N2O5/c10-5(8(13)14)1-4-2-6(9(15)16)11-7(12)3-4/h2-3,5H,1,10H2,(H,11,12)(H,13,14)(H,15,16)/t5-/m0/s1 |
| InChI Key | ZFXWNLZXWXOKAY-YFKPBYRVSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C9H10N2O5 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.05897142 g/mol |
| Topological Polar Surface Area (TPSA) | 130.00 Ų |
| XlogP | -3.80 |
| 142179-90-6 |
| (alphaS)-alpha-Amino-6-carboxy-1,2-dihydro-2-oxo-4-pyridinepropanoic acid |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 95.98% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.75% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.24% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.62% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.70% | 91.11% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 90.20% | 90.20% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.25% | 99.17% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 86.05% | 97.21% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 85.05% | 92.29% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.89% | 90.17% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.85% | 93.00% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 82.53% | 89.34% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.14% | 96.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.74% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10331264 |
| LOTUS | LTS0198970 |
| wikiData | Q105374887 |