Almadioxide
| Internal ID | 7b3fbc40-fa64-408a-83ea-ba358aa6264a |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Chamigranes |
| IUPAC Name | (1R,3S,4S,6R,8S,10S,12R)-3-bromo-4-chloro-4,12,13,13-tetramethyl-7,11-dioxatetracyclo[6.4.1.01,6.010,12]tridecane |
| SMILES (Canonical) | CC1(C2CC3C(C14CC(C(CC4O2)(C)Cl)Br)(O3)C)C |
| SMILES (Isomeric) | C[C@@]1(C[C@@H]2[C@]3(C[C@@H]1Br)[C@@]4([C@@H](O4)C[C@@H](C3(C)C)O2)C)Cl |
| InChI | InChI=1S/C15H22BrClO2/c1-12(2)9-5-10-14(4,19-10)15(12)6-8(16)13(3,17)7-11(15)18-9/h8-11H,5-7H2,1-4H3/t8-,9-,10-,11+,13-,14-,15-/m0/s1 |
| InChI Key | FRPLQWPAMFUPFL-UENJMYAUSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H22BrClO2 |
| Molecular Weight | 349.69 g/mol |
| Exact Mass | 348.04917 g/mol |
| Topological Polar Surface Area (TPSA) | 21.80 Ų |
| XlogP | 3.50 |
| (1R,3S,4S,6R,8S,10S,12R)-3-bromo-4-chloro-4,12,13,13-tetramethyl-7,11-dioxatetracyclo[6.4.1.01,6.010,12]tridecane |
| (1R,3S,4S,6R,8S,10S,12R)-3-bromo-4-chloro-4,12,13,13-tetramethyl-7,11-dioxatetracyclo(6.4.1.01,6.010,12)tridecane |
| (3S,4S,10S,12R)-3-bromo-4-chloro-4,12,13,13-tetramethyl-7,11-dioxatetracyclo(6.4.1.01,6.010,12)tridecane |
| (3S,4S,10S,12R)-3-bromo-4-chloro-4,12,13,13-tetramethyl-7,11-dioxatetracyclo[6.4.1.01,6.010,12]tridecane |
| RefChem:110927 |
| 119765-94-5 |
| CHEBI:206624 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.19% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.66% | 91.11% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 89.85% | 92.94% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.56% | 97.25% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 88.87% | 96.61% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.69% | 96.77% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.19% | 97.09% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 85.99% | 85.11% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 85.55% | 92.29% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.20% | 90.17% |
| CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 84.79% | 95.27% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 81.67% | 95.38% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.43% | 97.14% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.97% | 92.88% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.32% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 14191353 |
| LOTUS | LTS0156690 |
| wikiData | Q105000354 |