Allosedamine
Internal ID | fd3b1f81-f41e-425c-aac2-be7fc9f3813a |
Taxonomy | Organic nitrogen compounds > Organonitrogen compounds > Amines > Aralkylamines |
IUPAC Name | 2-(1-methylpiperidin-2-yl)-1-phenylethanol |
SMILES (Canonical) | CN1CCCCC1CC(C2=CC=CC=C2)O |
SMILES (Isomeric) | CN1CCCCC1CC(C2=CC=CC=C2)O |
InChI | InChI=1S/C14H21NO/c1-15-10-6-5-9-13(15)11-14(16)12-7-3-2-4-8-12/h2-4,7-8,13-14,16H,5-6,9-11H2,1H3 |
InChI Key | GOWRYACIDZSIHI-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C14H21NO |
Molecular Weight | 219.32 g/mol |
Exact Mass | 219.162314293 g/mol |
Topological Polar Surface Area (TPSA) | 23.50 Ų |
XlogP | 2.40 |
497-89-2 |
d,l-Sedamin |
GOWRYACIDZSIHI-UHFFFAOYSA-N |
NSC340064 |
AKOS040740361 |
NSC-340064 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.55% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 97.85% | 98.95% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.85% | 90.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.84% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.66% | 85.14% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.46% | 97.25% |
CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 86.20% | 93.81% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.94% | 93.56% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 83.31% | 89.62% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.35% | 95.89% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 81.52% | 83.82% |
CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 81.22% | 96.25% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.61% | 100.00% |
CHEMBL240 | Q12809 | HERG | 80.34% | 89.76% |
CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 80.05% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Hylotelephium ewersii |
Sedum acre |
PubChem | 433956 |
LOTUS | LTS0131092 |
wikiData | Q104375985 |