Alhagidin
Internal ID | a572eab7-43de-4937-ab0d-aa2e0f2ebc41 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 7-[(2S,4S,5S)-4,5-dihydroxy-3-[(2S,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-[[(2R,3S,5R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxy-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-2,3-dihydrochromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC(=C4C(=O)CC(OC4=C3)C5=CC(=C(C=C5)OC)O)O)OC6C(C(C(C(O6)CO)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | CC1[C@@H](C([C@@H]([C@@H](O1)OCC2[C@H]([C@@H](C([C@@H](O2)OC3=CC(=C4C(=O)CC(OC4=C3)C5=CC(=C(C=C5)OC)O)O)O[C@H]6C([C@H]([C@@H](C(O6)CO)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C34H44O20/c1-11-23(39)26(42)29(45)32(49-11)48-10-21-25(41)28(44)31(54-33-30(46)27(43)24(40)20(9-35)52-33)34(53-21)50-13-6-15(37)22-16(38)8-18(51-19(22)7-13)12-3-4-17(47-2)14(36)5-12/h3-7,11,18,20-21,23-37,39-46H,8-10H2,1-2H3/t11?,18?,20?,21?,23-,24+,25+,26?,27-,28-,29-,30?,31?,32+,33-,34+/m0/s1 |
InChI Key | RYTOQEJVKIKIBZ-QLJTZZHKSA-N |
Popularity | 3 references in papers |
Molecular Formula | C34H44O20 |
Molecular Weight | 772.70 g/mol |
Exact Mass | 772.24259379 g/mol |
Topological Polar Surface Area (TPSA) | 313.00 Ų |
XlogP | -2.70 |
5,7,3'-Trihydroxy-4'-methoxyflavanone 7-galactosyl-(1->2)-[rhamnosyl-(1->6)]glucoside |
LMPK12140381 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.38% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.30% | 96.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.23% | 94.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.90% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.84% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.34% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 93.87% | 98.95% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 93.26% | 96.21% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.34% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 90.75% | 90.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 90.57% | 86.92% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 90.34% | 97.36% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.21% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.65% | 99.17% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.46% | 85.14% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 86.43% | 94.80% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.63% | 96.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.13% | 94.45% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 83.85% | 95.78% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 83.80% | 91.49% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.75% | 94.73% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.01% | 99.15% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.66% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Alhagi maurorum |
PubChem | 42607984 |
LOTUS | LTS0197903 |
wikiData | Q105248136 |