Alanyl-glycyl-serine
| Internal ID | ba9dbcb2-ebfb-47a0-9027-d4bd76c3f568 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides |
| IUPAC Name | (2S)-2-[[2-[[(2S)-2-aminopropanoyl]amino]acetyl]amino]-3-hydroxypropanoic acid |
| SMILES (Canonical) | CC(C(=O)NCC(=O)NC(CO)C(=O)O)N |
| SMILES (Isomeric) | C[C@@H](C(=O)NCC(=O)N[C@@H](CO)C(=O)O)N |
| InChI | InChI=1S/C8H15N3O5/c1-4(9)7(14)10-2-6(13)11-5(3-12)8(15)16/h4-5,12H,2-3,9H2,1H3,(H,10,14)(H,11,13)(H,15,16)/t4-,5-/m0/s1 |
| InChI Key | NBTGEURICRTMGL-WHFBIAKZSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C8H15N3O5 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.10117059 g/mol |
| Topological Polar Surface Area (TPSA) | 142.00 Ų |
| XlogP | -5.00 |
| L-alanylglycyl-L-serine |
| 85807-50-7 |
| DTXSID10235088 |
| RefChem:924384 |
| DTXCID10157579 |
| (2S)-2-((2-(((2S)-2-aminopropanoyl)amino)acetyl)amino)-3-hydroxypropanoic acid |
| Ala-gly-ser |
| L-Ala-Gly-L-Ser |
| L-Alanyl-glycyl-L-serine |
| A-G-S |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.54% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.90% | 98.95% |
| CHEMBL236 | P41143 | Delta opioid receptor | 93.71% | 99.35% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.75% | 90.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.27% | 96.09% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 90.28% | 100.00% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 88.28% | 95.93% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.96% | 94.45% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 87.62% | 92.29% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 87.57% | 90.20% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 87.36% | 97.21% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 87.28% | 89.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.83% | 99.17% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 86.63% | 96.67% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.51% | 96.95% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.76% | 93.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.11% | 91.11% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.77% | 96.00% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.60% | 96.47% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 83.39% | 97.23% |
| CHEMBL3286 | P00749 | Urokinase-type plasminogen activator | 83.32% | 97.88% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 82.87% | 89.50% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.52% | 91.19% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.27% | 90.71% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 80.18% | 96.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 135103 |
| LOTUS | LTS0093345 |
| wikiData | Q27140456 |