Ala-Ser-Gly-Trp-Val-Ala-Abu-Leu-Abu-Ile-Glu-Ala-Gly-Abu-Val-Ile-Ala-Ala-Ala
| Internal ID | 4c60fd53-4c3b-4d5b-9cbd-2e3a175f67cf |
| Taxonomy | Organic Polymers > Polypeptides |
| IUPAC Name | (1R,4S,5R,8S,11R,12S,15R,21R,22S,25R,28S,33S,36S,41S,44S)-11-[[(3R,6S,9S,15S,18R)-18-amino-15-(hydroxymethyl)-9-(1H-indol-3-ylmethyl)-5,8,11,14,17-pentaoxo-6-propan-2-yl-1-thia-4,7,10,13,16-pentazacyclononadecane-3-carbonyl]amino]-33,44-bis[(2S)-butan-2-yl]-41-(2-carboxyethyl)-4,12,22,28-tetramethyl-8-(2-methylpropyl)-7,10,16,19,23,27,30,32,35,38,40,43,46-tridecaoxo-36-propan-2-yl-3,13,23lambda4-trithia-6,9,17,20,26,29,31,34,37,39,42,45-dodecazatricyclo[19.9.8.85,15]hexatetracontane-25-carboxylic acid |
| SMILES (Canonical) | CCC(C)C1C(=O)NC(C(=O)NC2CSC(C(C(=O)NC(C(=O)NC(C(SCC3C(=O)NC(C(=O)NC(CS(=O)C(C(C(=O)NC(C(=O)NC(C(=O)N3)C(C)CC)C(C)C)NC(=O)CNC2=O)C)C(=O)O)C)C)C(=O)N1)CC(C)C)NC(=O)C4CSCC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)NC(C(=O)N4)C(C)C)CC5=CNC6=CC=CC=C65)CO)N)C)CCC(=O)O |
| SMILES (Isomeric) | CC[C@H](C)[C@H]1C(=O)N[C@H](C(=O)N[C@H]2CS[C@H]([C@@H](C(=O)N[C@H](C(=O)N[C@@H]([C@@H](SC[C@H]3C(=O)N[C@H](C(=O)N[C@@H](CS(=O)[C@H]([C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N3)[C@@H](C)CC)C(C)C)NC(=O)CNC2=O)C)C(=O)O)C)C)C(=O)N1)CC(C)C)NC(=O)[C@@H]4CSC[C@@H](C(=O)N[C@H](C(=O)NCC(=O)N[C@H](C(=O)N[C@H](C(=O)N4)C(C)C)CC5=CNC6=CC=CC=C65)CO)N)C)CCC(=O)O |
| InChI | InChI=1S/C81H124N20O24S4/c1-15-37(9)60-76(118)88-47(21-22-57(105)106)69(111)91-52-31-127-40(12)62(101-73(115)51-30-126-29-45(82)66(108)90-50(28-102)67(109)84-26-55(103)87-49(71(113)96-58(35(5)6)74(116)92-51)24-43-25-83-46-20-18-17-19-44(43)46)78(120)89-48(23-34(3)4)70(112)100-63(79(121)99-60)41(13)128-32-53-72(114)86-39(11)65(107)94-54(81(123)124)33-129(125)42(14)64(95-56(104)27-85-68(52)110)80(122)97-59(36(7)8)75(117)98-61(38(10)16-2)77(119)93-53/h17-20,25,34-42,45,47-54,58-64,83,102H,15-16,21-24,26-33,82H2,1-14H3,(H,84,109)(H,85,110)(H,86,114)(H,87,103)(H,88,118)(H,89,120)(H,90,108)(H,91,111)(H,92,116)(H,93,119)(H,94,107)(H,95,104)(H,96,113)(H,97,122)(H,98,117)(H,99,121)(H,100,112)(H,101,115)(H,105,106)(H,123,124)/t37-,38-,39-,40-,41-,42-,45-,47-,48-,49-,50-,51-,52-,53-,54-,58-,59-,60-,61-,62-,63-,64-,129?/m0/s1 |
| InChI Key | LOHAAMWDKJNSML-MOPWJEJXSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C81H124N20O24S4 |
| Molecular Weight | 1890.20 g/mol |
| Exact Mass | 1888.7980196 g/mol |
| Topological Polar Surface Area (TPSA) | 773.00 Ų |
| XlogP | -3.40 |
| [[(3R,6S,9S,15S,18R)-18-amino-15-(hydroxymethyl)-9-(1H-indol-3-ylmethyl)-6-isopropyl-5,8,11,14,17-pentaoxo-1-thia-4,7,10,13,16-pentazacyclononadecane-3-carbonyl]amino]-(2-carboxyethyl)-isobutyl-isopropyl-tetramethyl-bis[(1S)-1-methylpropyl]-tridecaoxo-[?]carboxylic acid |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL220 | P22303 | Acetylcholinesterase | 99.62% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.59% | 91.11% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.48% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.37% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.95% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.91% | 90.17% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 97.48% | 97.64% |
| CHEMBL4071 | P08311 | Cathepsin G | 96.89% | 94.64% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 96.44% | 93.10% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.61% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.89% | 99.23% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.66% | 97.09% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 92.59% | 96.47% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.10% | 94.75% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 92.03% | 90.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.01% | 97.25% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 91.66% | 88.56% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 91.52% | 96.90% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 91.34% | 94.62% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 89.38% | 97.14% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 88.59% | 90.24% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 88.05% | 95.93% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 87.32% | 98.59% |
| CHEMBL2093869 | P05106 | Integrin alpha-IIb/beta-3 | 86.88% | 95.42% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 86.87% | 96.61% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 86.19% | 90.20% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 85.90% | 90.08% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 85.88% | 96.31% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 85.71% | 91.71% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 85.61% | 94.23% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.47% | 100.00% |
| CHEMBL1949 | P62937 | Cyclophilin A | 84.98% | 98.57% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.44% | 98.75% |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 84.38% | 90.71% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 83.75% | 83.10% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.75% | 89.00% |
| CHEMBL2443 | P49862 | Kallikrein 7 | 82.54% | 94.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.46% | 93.56% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.07% | 95.50% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 80.59% | 98.03% |
| CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 80.55% | 85.83% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.48% | 89.62% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 80.37% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 16204841 |
| LOTUS | LTS0082646 |
| wikiData | Q105154704 |