Ajugasalicioside G
Internal ID | d114c4ad-a77a-4c9d-888b-dee326413d30 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | [(2R,3S,4S,5R,6R)-6-[[(3S,5S,9R,10S,13S,14S,16S,17S)-17-[(1R)-1-[(2S,3S,4S,5S)-5-(acetyloxymethyl)-4-ethyl-3-hydroxy-5-methyloxolan-2-yl]ethyl]-16,17-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl acetate |
SMILES (Canonical) | CCC1C(C(OC1(C)COC(=O)C)C(C)C2(C(CC3C2(CCC4C3=CCC5C4(CCC(C5)OC6C(C(C(C(O6)COC(=O)C)O)O)O)C)C)O)O)O |
SMILES (Isomeric) | CC[C@H]1[C@@H]([C@@H](O[C@]1(C)COC(=O)C)[C@@H](C)[C@]2([C@H](C[C@@H]3[C@@]2(CC[C@H]4C3=CC[C@@H]5[C@@]4(CC[C@@H](C5)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)COC(=O)C)O)O)O)C)C)O)O)O |
InChI | InChI=1S/C39H62O13/c1-8-25-30(43)34(52-38(25,7)18-49-21(4)41)19(2)39(47)29(42)16-27-24-10-9-22-15-23(11-13-36(22,5)26(24)12-14-37(27,39)6)50-35-33(46)32(45)31(44)28(51-35)17-48-20(3)40/h10,19,22-23,25-35,42-47H,8-9,11-18H2,1-7H3/t19-,22+,23+,25+,26+,27+,28-,29+,30+,31-,32+,33-,34+,35-,36+,37+,38-,39-/m1/s1 |
InChI Key | LZDFSWIWYVSBBB-WGRSZSELSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C39H62O13 |
Molecular Weight | 738.90 g/mol |
Exact Mass | 738.41904203 g/mol |
Topological Polar Surface Area (TPSA) | 202.00 Ų |
XlogP | 1.50 |
CHEMBL486217 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.78% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.70% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.60% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.15% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.81% | 97.09% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 94.60% | 96.61% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 90.69% | 92.50% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 88.56% | 94.23% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.03% | 95.89% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.17% | 93.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.09% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 86.91% | 98.95% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.74% | 92.62% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.57% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.47% | 86.33% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.18% | 100.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.13% | 96.95% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.31% | 94.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.96% | 94.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.39% | 82.69% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.09% | 96.21% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.95% | 96.77% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 81.86% | 92.86% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 81.70% | 94.62% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.55% | 96.90% |
CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 81.17% | 91.65% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 81.16% | 97.21% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 80.79% | 97.50% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.61% | 95.50% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 80.30% | 95.71% |
CHEMBL5028 | O14672 | ADAM10 | 80.29% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ajuga salicifolia |
PubChem | 10887132 |
LOTUS | LTS0099147 |
wikiData | Q105159789 |