Aglaroxin E
Internal ID | 1ee15f9c-09c3-4ec0-b4cf-0f54818e2282 |
Taxonomy | Organoheterocyclic compounds > Benzofurans > Flavaglines |
IUPAC Name | (3aR,8bS)-3a-(3,4-dimethoxyphenyl)-1,8b-dihydroxy-6,8-dimethoxy-N,N-dimethyl-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxamide |
SMILES (Canonical) | CN(C)C(=O)C1C(C2(C(C1O)(C3=C(O2)C=C(C=C3OC)OC)O)C4=CC(=C(C=C4)OC)OC)C5=CC=CC=C5 |
SMILES (Isomeric) | CN(C)C(=O)C1C([C@]2([C@@](C1O)(C3=C(O2)C=C(C=C3OC)OC)O)C4=CC(=C(C=C4)OC)OC)C5=CC=CC=C5 |
InChI | InChI=1S/C30H33NO8/c1-31(2)28(33)24-25(17-10-8-7-9-11-17)30(18-12-13-20(36-4)21(14-18)37-5)29(34,27(24)32)26-22(38-6)15-19(35-3)16-23(26)39-30/h7-16,24-25,27,32,34H,1-6H3/t24?,25?,27?,29-,30-/m0/s1 |
InChI Key | SKYJJPBOOAAPMV-UYJCSVOXSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C30H33NO8 |
Molecular Weight | 535.60 g/mol |
Exact Mass | 535.22061701 g/mol |
Topological Polar Surface Area (TPSA) | 107.00 Ų |
XlogP | 2.80 |
3'-Methoxyrocaglamide |
glaroxine E; C-3'-Methoxyrocaglamide |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.68% | 96.09% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 95.84% | 89.44% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.75% | 95.56% |
CHEMBL240 | Q12809 | HERG | 93.62% | 89.76% |
CHEMBL2581 | P07339 | Cathepsin D | 89.96% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.63% | 86.33% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.96% | 97.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.10% | 91.11% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 87.19% | 90.20% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.83% | 96.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.40% | 95.50% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.10% | 91.19% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.90% | 99.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.48% | 89.00% |
CHEMBL2535 | P11166 | Glucose transporter | 82.63% | 98.75% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 82.19% | 89.67% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.40% | 94.00% |
CHEMBL5028 | O14672 | ADAM10 | 80.33% | 97.50% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.15% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aglaia odorata |
PubChem | 129316971 |
LOTUS | LTS0173216 |
wikiData | Q105255135 |