(2S,3R,4S,5S,6R)-2-[[(4bR,5S,9bR,10S)-1,6-dihydroxy-5,10-bis(4-hydroxyphenyl)-4b,9b-dimethyl-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5,10-dihydroindeno[2,1-a]inden-8-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | e46e7234-2b7b-4442-86a2-ec620324c77a |
Taxonomy | Lignans, neolignans and related compounds > Lignan glycosides |
IUPAC Name | (2S,3R,4S,5S,6R)-2-[[(4bR,5S,9bR,10S)-1,6-dihydroxy-5,10-bis(4-hydroxyphenyl)-4b,9b-dimethyl-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5,10-dihydroindeno[2,1-a]inden-8-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC12C(C3=C(C1(C(C4=C2C=C(C=C4O)OC5C(C(C(C(O5)CO)O)O)O)C6=CC=C(C=C6)O)C)C=C(C=C3O)OC7C(C(C(C(O7)CO)O)O)O)C8=CC=C(C=C8)O |
SMILES (Isomeric) | C[C@]12[C@@H](C3=C([C@]1([C@@H](C4=C2C=C(C=C4O)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)C6=CC=C(C=C6)O)C)C=C(C=C3O)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)C8=CC=C(C=C8)O |
InChI | InChI=1S/C42H46O16/c1-41-23-11-21(55-39-37(53)35(51)33(49)27(15-43)57-39)13-25(47)29(23)32(18-5-9-20(46)10-6-18)42(41,2)24-12-22(56-40-38(54)36(52)34(50)28(16-44)58-40)14-26(48)30(24)31(41)17-3-7-19(45)8-4-17/h3-14,27-28,31-40,43-54H,15-16H2,1-2H3/t27-,28-,31-,32-,33-,34-,35+,36+,37-,38-,39-,40-,41+,42+/m1/s1 |
InChI Key | HEQJMQFXGQTBFK-XOKSSIBGSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C42H46O16 |
Molecular Weight | 806.80 g/mol |
Exact Mass | 806.27858538 g/mol |
Topological Polar Surface Area (TPSA) | 280.00 Ų |
XlogP | 2.00 |
There are no found synonyms. |
![2D Structure of (2S,3R,4S,5S,6R)-2-[[(4bR,5S,9bR,10S)-1,6-dihydroxy-5,10-bis(4-hydroxyphenyl)-4b,9b-dimethyl-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5,10-dihydroindeno[2,1-a]inden-8-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol 2D Structure of (2S,3R,4S,5S,6R)-2-[[(4bR,5S,9bR,10S)-1,6-dihydroxy-5,10-bis(4-hydroxyphenyl)-4b,9b-dimethyl-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5,10-dihydroindeno[2,1-a]inden-8-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/affdb4e0-8717-11ee-9b79-97742f11a794.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.57% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.45% | 96.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.32% | 91.49% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.35% | 97.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.89% | 94.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.72% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.42% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.28% | 90.00% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 86.73% | 96.21% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.55% | 94.73% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.96% | 99.15% |
CHEMBL2581 | P07339 | Cathepsin D | 84.83% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.77% | 86.33% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 84.45% | 93.10% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.42% | 91.71% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 83.89% | 94.62% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.71% | 99.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.48% | 89.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.85% | 92.94% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.06% | 95.56% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.53% | 85.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.09% | 86.92% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Carex distachya |
PubChem | 163092287 |
LOTUS | LTS0080558 |
wikiData | Q105026991 |