2-[[6-Hydroxy-4-(4-hydroxy-3,5-dimethoxyphenyl)-3-(hydroxymethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | 2089ad7b-f4ac-44fe-84ec-c5f63fac15b5 |
Taxonomy | Lignans, neolignans and related compounds > Lignan glycosides |
IUPAC Name | 2-[[6-hydroxy-4-(4-hydroxy-3,5-dimethoxyphenyl)-3-(hydroxymethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | COC1=CC(=CC(=C1O)OC)C2C(C(CC3=C2C=C(C=C3)O)COC4C(C(C(C(O4)CO)O)O)O)CO |
SMILES (Isomeric) | COC1=CC(=CC(=C1O)OC)C2C(C(CC3=C2C=C(C=C3)O)COC4C(C(C(C(O4)CO)O)O)O)CO |
InChI | InChI=1S/C26H34O11/c1-34-18-6-13(7-19(35-2)22(18)30)21-16-8-15(29)4-3-12(16)5-14(17(21)9-27)11-36-26-25(33)24(32)23(31)20(10-28)37-26/h3-4,6-8,14,17,20-21,23-33H,5,9-11H2,1-2H3 |
InChI Key | YVOLNWARBUBFLT-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H34O11 |
Molecular Weight | 522.50 g/mol |
Exact Mass | 522.21011190 g/mol |
Topological Polar Surface Area (TPSA) | 179.00 Ų |
XlogP | 0.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.76% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.04% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.12% | 85.14% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 93.97% | 89.62% |
CHEMBL2581 | P07339 | Cathepsin D | 93.90% | 98.95% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 93.70% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.28% | 99.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.54% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.85% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.64% | 95.89% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.61% | 92.94% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.12% | 89.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.59% | 90.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.02% | 94.73% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.14% | 92.62% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.76% | 94.45% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 80.66% | 83.57% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.35% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Pelargonium reniforme |
PubChem | 162901597 |
LOTUS | LTS0273515 |
wikiData | Q105365741 |