methyl 5,7-dihydroxy-7-methyl-1-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-4-carboxylate
Internal ID | 2438dd5c-b4a6-4b50-b6a2-0f648fb87130 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Iridoid O-glycosides |
IUPAC Name | methyl 5,7-dihydroxy-7-methyl-1-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-4-carboxylate |
SMILES (Canonical) | CC1(CC(C2C1C(OC=C2C(=O)OC)OC3C(C(C(C(O3)COC4C(C(C(C(O4)CO)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | CC1(CC(C2C1C(OC=C2C(=O)OC)OC3C(C(C(C(O3)COC4C(C(C(C(O4)CO)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C23H36O16/c1-23(33)3-8(25)11-7(19(32)34-2)5-35-20(12(11)23)39-22-18(31)16(29)14(27)10(38-22)6-36-21-17(30)15(28)13(26)9(4-24)37-21/h5,8-18,20-22,24-31,33H,3-4,6H2,1-2H3 |
InChI Key | FFKQCCZXUVIIPM-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H36O16 |
Molecular Weight | 568.50 g/mol |
Exact Mass | 568.20033506 g/mol |
Topological Polar Surface Area (TPSA) | 255.00 Ų |
XlogP | -4.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.41% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.30% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.12% | 85.14% |
CHEMBL4208 | P20618 | Proteasome component C5 | 91.50% | 90.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.49% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.32% | 97.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.15% | 90.17% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 86.66% | 96.61% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.58% | 94.73% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.10% | 92.50% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.84% | 96.00% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.33% | 95.50% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 81.60% | 95.93% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.57% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.26% | 89.00% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.20% | 96.90% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.40% | 95.83% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.09% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Phlomoides rotata |
Psydrax subcordatus |
PubChem | 162916689 |
LOTUS | LTS0176332 |
wikiData | Q104994518 |