5,7-dihydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-3-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one
Internal ID | 7bf01f0a-3f4f-4030-bd17-9050869389bb |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | 5,7-dihydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-3-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=C(OC3=C(C(=CC(=C3C2=O)O)O)CC=C(C)C)C4=CC=C(C=C4)OC)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)OC2=C(OC3=C(C(=CC(=C3C2=O)O)O)CC=C(C)C)C4=CC=C(C=C4)OC)O)O)O |
InChI | InChI=1S/C27H30O10/c1-12(2)5-10-16-17(28)11-18(29)19-21(31)26(37-27-23(33)22(32)20(30)13(3)35-27)24(36-25(16)19)14-6-8-15(34-4)9-7-14/h5-9,11,13,20,22-23,27-30,32-33H,10H2,1-4H3/t13-,20-,22+,23+,27+/m0/s1 |
InChI Key | NGMYNFJANBHLKA-JOZACINJSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C27H30O10 |
Molecular Weight | 514.50 g/mol |
Exact Mass | 514.18389715 g/mol |
Topological Polar Surface Area (TPSA) | 155.00 Ų |
XlogP | 3.50 |
There are no found synonyms. |
![2D Structure of 5,7-dihydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-3-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one 2D Structure of 5,7-dihydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-3-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/afb7ae30-87e3-11ee-9c9d-75a7a3c3480b.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1827 | O76074 | Phosphodiesterase 5A |
160 nM |
IC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.81% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.19% | 91.49% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.49% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 95.42% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.95% | 85.14% |
CHEMBL3401 | O75469 | Pregnane X receptor | 94.66% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.29% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.26% | 89.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.61% | 99.15% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.88% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.93% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.23% | 94.45% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.08% | 90.00% |
CHEMBL240 | Q12809 | HERG | 85.49% | 89.76% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.10% | 96.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.51% | 86.92% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.47% | 96.09% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 81.73% | 97.36% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.48% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.26% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Epimedium sempervirens |
PubChem | 162982443 |
LOTUS | LTS0123976 |
wikiData | Q105179020 |