2-[[(2S)-1-[[(2R)-3-[[(2S)-2-[(2-aminoacetyl)amino]-3-(3-hydroxyphenyl)propanoyl]-methylamino]-1-[[5-(2,4-dioxopyrimidin-1-yl)-4-hydroxyoxolan-2-ylidene]methylamino]-1-oxobutan-2-yl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamoylamino]-3-(3-hydroxyphenyl)propanoic acid
| Internal ID | 482bca99-d706-449d-ba1f-fa8a6ead7b02 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides |
| IUPAC Name | 2-[[(2S)-1-[[(2R)-3-[[(2S)-2-[(2-aminoacetyl)amino]-3-(3-hydroxyphenyl)propanoyl]-methylamino]-1-[[5-(2,4-dioxopyrimidin-1-yl)-4-hydroxyoxolan-2-ylidene]methylamino]-1-oxobutan-2-yl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamoylamino]-3-(3-hydroxyphenyl)propanoic acid |
| SMILES (Canonical) | CC(C(C(=O)NC=C1CC(C(O1)N2C=CC(=O)NC2=O)O)NC(=O)C(CCSC)NC(=O)NC(CC3=CC(=CC=C3)O)C(=O)O)N(C)C(=O)C(CC4=CC(=CC=C4)O)NC(=O)CN |
| SMILES (Isomeric) | CC([C@H](C(=O)NC=C1CC(C(O1)N2C=CC(=O)NC2=O)O)NC(=O)[C@H](CCSC)NC(=O)NC(CC3=CC(=CC=C3)O)C(=O)O)N(C)C(=O)[C@H](CC4=CC(=CC=C4)O)NC(=O)CN |
| InChI | InChI=1S/C40H51N9O13S/c1-21(48(2)36(57)28(43-32(54)19-41)16-22-6-4-8-24(50)14-22)33(35(56)42-20-26-18-30(52)37(62-26)49-12-10-31(53)46-40(49)61)47-34(55)27(11-13-63-3)44-39(60)45-29(38(58)59)17-23-7-5-9-25(51)15-23/h4-10,12,14-15,20-21,27-30,33,37,50-52H,11,13,16-19,41H2,1-3H3,(H,42,56)(H,43,54)(H,47,55)(H,58,59)(H2,44,45,60)(H,46,53,61)/t21?,27-,28-,29?,30?,33+,37?/m0/s1 |
| InChI Key | DODUWDVIPJZWOY-JHYHWTEUSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C40H51N9O13S |
| Molecular Weight | 898.00 g/mol |
| Exact Mass | 897.33270389 g/mol |
| Topological Polar Surface Area (TPSA) | 357.00 Ų |
| XlogP | -3.20 |
| Atomic LogP (AlogP) | -1.68 |
| H-Bond Acceptor | 15 |
| H-Bond Donor | 11 |
| Rotatable Bonds | 20 |
| There are no found synonyms. |
![2D Structure of 2-[[(2S)-1-[[(2R)-3-[[(2S)-2-[(2-aminoacetyl)amino]-3-(3-hydroxyphenyl)propanoyl]-methylamino]-1-[[5-(2,4-dioxopyrimidin-1-yl)-4-hydroxyoxolan-2-ylidene]methylamino]-1-oxobutan-2-yl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamoylamino]-3-(3-hydroxyphenyl)propanoic acid](https://plantaedb.com/storage/docs/compounds/2023/11/af942200-85c7-11ee-8560-abfe284eabe3.jpg "2D Structure of 2-[[(2S)-1-[[(2R)-3-[[(2S)-2-[(2-aminoacetyl)amino]-3-(3-hydroxyphenyl)propanoyl]-methylamino]-1-[[5-(2,4-dioxopyrimidin-1-yl)-4-hydroxyoxolan-2-ylidene]methylamino]-1-oxobutan-2-yl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamoylamino]-3-(3-hydroxyphenyl)propanoic acid")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.7820 | 78.20% |
| Caco-2 | - | 0.8718 | 87.18% |
| Blood Brain Barrier | - | 0.7000 | 70.00% |
| Human oral bioavailability | - | 0.7143 | 71.43% |
| Subcellular localzation | Mitochondria | 0.4130 | 41.30% |
| OATP2B1 inhibitior | - | 0.7148 | 71.48% |
| OATP1B1 inhibitior | + | 0.8038 | 80.38% |
| OATP1B3 inhibitior | + | 0.9290 | 92.90% |
| MATE1 inhibitior | - | 0.9200 | 92.00% |
| OCT2 inhibitior | - | 0.8061 | 80.61% |
| BSEP inhibitior | + | 0.8839 | 88.39% |
| P-glycoprotein inhibitior | + | 0.7465 | 74.65% |
| P-glycoprotein substrate | + | 0.8520 | 85.20% |
| CYP3A4 substrate | + | 0.7328 | 73.28% |
| CYP2C9 substrate | - | 0.7943 | 79.43% |
| CYP2D6 substrate | - | 0.8525 | 85.25% |
| CYP3A4 inhibition | + | 0.5000 | 50.00% |
| CYP2C9 inhibition | - | 0.7621 | 76.21% |
| CYP2C19 inhibition | - | 0.8290 | 82.90% |
| CYP2D6 inhibition | - | 0.8628 | 86.28% |
| CYP1A2 inhibition | - | 0.8357 | 83.57% |
| CYP2C8 inhibition | + | 0.7283 | 72.83% |
| CYP inhibitory promiscuity | - | 0.9080 | 90.80% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.8700 | 87.00% |
| Carcinogenicity (trinary) | Non-required | 0.5504 | 55.04% |
| Eye corrosion | - | 0.9838 | 98.38% |
| Eye irritation | - | 0.9086 | 90.86% |
| Skin irritation | - | 0.7674 | 76.74% |
| Skin corrosion | - | 0.9246 | 92.46% |
| Ames mutagenesis | - | 0.6200 | 62.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.3950 | 39.50% |
| Micronuclear | + | 0.8400 | 84.00% |
| Hepatotoxicity | + | 0.5375 | 53.75% |
| skin sensitisation | - | 0.8568 | 85.68% |
| Respiratory toxicity | + | 0.8111 | 81.11% |
| Reproductive toxicity | + | 0.9889 | 98.89% |
| Mitochondrial toxicity | + | 0.8500 | 85.00% |
| Nephrotoxicity | - | 0.8147 | 81.47% |
| Acute Oral Toxicity (c) | III | 0.5984 | 59.84% |
| Estrogen receptor binding | + | 0.8234 | 82.34% |
| Androgen receptor binding | + | 0.7542 | 75.42% |
| Thyroid receptor binding | + | 0.5783 | 57.83% |
| Glucocorticoid receptor binding | + | 0.5681 | 56.81% |
| Aromatase binding | + | 0.6074 | 60.74% |
| PPAR gamma | + | 0.7715 | 77.15% |
| Honey bee toxicity | - | 0.6517 | 65.17% |
| Biodegradation | - | 0.8250 | 82.50% |
| Crustacea aquatic toxicity | - | 0.5200 | 52.00% |
| Fish aquatic toxicity | + | 0.8526 | 85.26% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.75% | 98.95% |
| CHEMBL236 | P41143 | Delta opioid receptor | 99.69% | 99.35% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 99.31% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.98% | 96.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 97.19% | 95.93% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.06% | 95.56% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 95.65% | 93.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.36% | 97.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.34% | 99.17% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 94.82% | 98.33% |
| CHEMBL4072 | P07858 | Cathepsin B | 94.14% | 93.67% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 93.02% | 90.08% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 92.34% | 90.71% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 92.34% | 97.14% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 92.19% | 95.58% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.69% | 91.19% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 88.85% | 85.11% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 88.25% | 82.86% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 88.04% | 93.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.08% | 98.75% |
| CHEMBL3837 | P07711 | Cathepsin L | 86.64% | 96.61% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 86.56% | 100.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.45% | 90.17% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.17% | 94.73% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.97% | 89.00% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 85.87% | 95.00% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 84.98% | 85.31% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 84.76% | 98.59% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.08% | 91.71% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 83.97% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.82% | 95.89% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.13% | 95.89% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 82.67% | 88.56% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 82.48% | 92.29% |
| CHEMBL233 | P35372 | Mu opioid receptor | 81.82% | 97.93% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 81.80% | 90.20% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.42% | 91.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 145720597 |
| LOTUS | LTS0142549 |
| wikiData | Q104985933 |