5-[(1S)-1-[(1R,4S,4aS,6S,8aR)-4-hydroxy-6-(2-hydroxypropan-2-yl)-4,8a-dimethyl-1,2,3,4a,5,6,7,8-octahydronaphthalen-1-yl]-3-methylbutyl]-2,4,6-trihydroxybenzene-1,3-dicarbaldehyde
Internal ID | 10c53be8-290b-43bc-84c6-fbfdb69017d2 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Eudesmane, isoeudesmane or cycloeudesmane sesquiterpenoids |
IUPAC Name | 5-[(1S)-1-[(1R,4S,4aS,6S,8aR)-4-hydroxy-6-(2-hydroxypropan-2-yl)-4,8a-dimethyl-1,2,3,4a,5,6,7,8-octahydronaphthalen-1-yl]-3-methylbutyl]-2,4,6-trihydroxybenzene-1,3-dicarbaldehyde |
SMILES (Canonical) | CC(C)CC(C1CCC(C2C1(CCC(C2)C(C)(C)O)C)(C)O)C3=C(C(=C(C(=C3O)C=O)O)C=O)O |
SMILES (Isomeric) | CC(C)C[C@@H]([C@H]1CC[C@]([C@@H]2[C@@]1(CC[C@@H](C2)C(C)(C)O)C)(C)O)C3=C(C(=C(C(=C3O)C=O)O)C=O)O |
InChI | InChI=1S/C28H42O7/c1-15(2)11-17(22-24(32)18(13-29)23(31)19(14-30)25(22)33)20-8-10-28(6,35)21-12-16(26(3,4)34)7-9-27(20,21)5/h13-17,20-21,31-35H,7-12H2,1-6H3/t16-,17-,20+,21-,27+,28-/m0/s1 |
InChI Key | PXQFFMATXFLUPK-DMVNJTFYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C28H42O7 |
Molecular Weight | 490.60 g/mol |
Exact Mass | 490.29305367 g/mol |
Topological Polar Surface Area (TPSA) | 135.00 Ų |
XlogP | 5.30 |
179388-54-6 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.25% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 97.63% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.49% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.28% | 95.56% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 92.58% | 93.56% |
CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 92.56% | 90.93% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.38% | 96.09% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 90.41% | 97.79% |
CHEMBL268 | P43235 | Cathepsin K | 89.99% | 96.85% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 88.16% | 100.00% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 86.89% | 98.11% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.78% | 100.00% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 85.29% | 94.08% |
CHEMBL237 | P41145 | Kappa opioid receptor | 84.85% | 98.10% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 84.56% | 85.31% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.26% | 93.00% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 83.90% | 94.23% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.78% | 96.90% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.50% | 97.09% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.70% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Eucalyptus globulus |
PubChem | 133561815 |
LOTUS | LTS0230520 |
wikiData | Q105216328 |