(6-Hydroxy-3,5-dimethyl-9-propanoyloxy-5,6,7,8-tetrahydrobenzo[f][1]benzofuran-4-yl)methyl 2-methylbut-2-enoate
Internal ID | f03b6ad1-23de-4818-85b3-16e175772d49 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Eremophilane, 8,9-secoeremophilane and furoeremophilane sesquiterpenoids |
IUPAC Name | (6-hydroxy-3,5-dimethyl-9-propanoyloxy-5,6,7,8-tetrahydrobenzo[f][1]benzofuran-4-yl)methyl 2-methylbut-2-enoate |
SMILES (Canonical) | CCC(=O)OC1=C2C(=C(C3=C1CCC(C3C)O)COC(=O)C(=CC)C)C(=CO2)C |
SMILES (Isomeric) | CCC(=O)OC1=C2C(=C(C3=C1CCC(C3C)O)COC(=O)C(=CC)C)C(=CO2)C |
InChI | InChI=1S/C23H28O6/c1-6-12(3)23(26)28-11-16-19-13(4)10-27-22(19)21(29-18(25)7-2)15-8-9-17(24)14(5)20(15)16/h6,10,14,17,24H,7-9,11H2,1-5H3 |
InChI Key | TYOANDKPHLTYEY-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H28O6 |
Molecular Weight | 400.50 g/mol |
Exact Mass | 400.18858861 g/mol |
Topological Polar Surface Area (TPSA) | 86.00 Ų |
XlogP | 4.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.48% | 89.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.36% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.05% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.33% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.44% | 99.17% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.00% | 90.17% |
CHEMBL2664 | P23526 | Adenosylhomocysteinase | 84.64% | 86.67% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.47% | 99.23% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 82.83% | 83.82% |
CHEMBL2581 | P07339 | Cathepsin D | 82.76% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.81% | 94.45% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.44% | 93.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.41% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.13% | 86.33% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.12% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Senecio lydenburgensis |
PubChem | 163009629 |
LOTUS | LTS0020918 |
wikiData | Q105267612 |