[(3aS,4R,6R,6aS,8S,9aR,9bR)-8-hydroxy-3,9-dimethylidene-2-oxospiro[3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-6,2'-oxirane]-4-yl] acetate
| Internal ID | a1121580-d28f-404c-bf04-18682e9a8c43 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Sesquiterpene lactones > Ambrosanolides and secoambrosanolides |
| IUPAC Name | [(3aS,4R,6R,6aS,8S,9aR,9bR)-8-hydroxy-3,9-dimethylidene-2-oxospiro[3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-6,2'-oxirane]-4-yl] acetate |
| SMILES (Canonical) | CC(=O)OC1CC2(CO2)C3CC(C(=C)C3C4C1C(=C)C(=O)O4)O |
| SMILES (Isomeric) | CC(=O)O[C@@H]1C[C@]2(CO2)[C@H]3C[C@@H](C(=C)[C@@H]3[C@@H]4[C@H]1C(=C)C(=O)O4)O |
| InChI | InChI=1S/C17H20O6/c1-7-11(19)4-10-13(7)15-14(8(2)16(20)23-15)12(22-9(3)18)5-17(10)6-21-17/h10-15,19H,1-2,4-6H2,3H3/t10-,11-,12+,13-,14-,15+,17-/m0/s1 |
| InChI Key | UQTXIRRPEBEPIU-JUNFRJDCSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.12598835 g/mol |
| Topological Polar Surface Area (TPSA) | 85.40 Ų |
| XlogP | 0.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.39% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.53% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.43% | 94.45% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 88.65% | 97.79% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.36% | 96.09% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 88.18% | 94.08% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.91% | 99.23% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.45% | 90.17% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.18% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.67% | 95.56% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.12% | 91.19% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.48% | 95.50% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.06% | 89.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.28% | 100.00% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.64% | 82.69% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.60% | 91.07% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.49% | 94.00% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 80.13% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Artemisia franserioides |
| PubChem | 162962544 |
| LOTUS | LTS0074586 |
| wikiData | Q105277456 |