(2R,3R,4S,5S,6R)-2-[[(1S,3R,6S,7S,8R,11R,12S,15R,16R)-15-[(2R,3S,4S,5R)-4-hydroxy-2-methoxy-5-(2-methylprop-1-enyl)oxolan-3-yl]-7-(hydroxymethyl)-7,12,16-trimethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | 8883a2f5-dc84-47fc-8595-2aee94a6133c |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | (2R,3R,4S,5S,6R)-2-[[(1S,3R,6S,7S,8R,11R,12S,15R,16R)-15-[(2R,3S,4S,5R)-4-hydroxy-2-methoxy-5-(2-methylprop-1-enyl)oxolan-3-yl]-7-(hydroxymethyl)-7,12,16-trimethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC(=CC1C(C(C(O1)OC)C2CCC3(C2(CCC45C3CCC6C4(C5)CCC(C6(C)CO)OC7C(C(C(C(O7)CO)O)O)O)C)C)O)C |
SMILES (Isomeric) | CC(=C[C@@H]1[C@H]([C@@H]([C@@H](O1)OC)[C@H]2CC[C@@]3([C@@]2(CC[C@]45[C@@H]3CC[C@@H]6[C@]4(C5)CC[C@@H]([C@]6(C)CO)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)C)C)O)C |
InChI | InChI=1S/C37H60O10/c1-19(2)15-21-27(40)26(31(44-6)45-21)20-9-11-35(5)24-8-7-23-33(3,18-39)25(47-32-30(43)29(42)28(41)22(16-38)46-32)10-12-36(23)17-37(24,36)14-13-34(20,35)4/h15,20-32,38-43H,7-14,16-18H2,1-6H3/t20-,21-,22-,23+,24-,25+,26+,27-,28-,29+,30-,31-,32+,33-,34-,35+,36-,37+/m1/s1 |
InChI Key | BOECQQUDFVMJFS-BSRPRUHBSA-N |
Popularity | 0 references in papers |
Molecular Formula | C37H60O10 |
Molecular Weight | 664.90 g/mol |
Exact Mass | 664.41864811 g/mol |
Topological Polar Surface Area (TPSA) | 158.00 Ų |
XlogP | 4.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.95% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.77% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.41% | 97.25% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 92.14% | 96.61% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 91.10% | 95.58% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.95% | 97.09% |
CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 90.69% | 97.47% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 88.68% | 96.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.50% | 95.89% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.49% | 94.75% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 88.46% | 95.50% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.94% | 100.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.48% | 92.94% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.80% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.84% | 86.33% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 85.63% | 100.00% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 84.84% | 97.53% |
CHEMBL2581 | P07339 | Cathepsin D | 84.63% | 98.95% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.77% | 97.14% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.27% | 92.62% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.91% | 96.21% |
CHEMBL233 | P35372 | Mu opioid receptor | 81.52% | 97.93% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 81.40% | 92.86% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 81.20% | 91.03% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.05% | 92.50% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.02% | 95.83% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 80.96% | 90.24% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.18% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Thalictrum squarrosum |
PubChem | 162847853 |
LOTUS | LTS0128415 |
wikiData | Q104939185 |