Aeruginosin 89-A
| Internal ID | 1383c9dc-f92e-4e59-9990-2b22467e5a9a |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Dipeptides |
| IUPAC Name | [4-[(2R)-3-[[(2R)-1-[(2S,3aS,6R,7aS)-2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]carbamoyl]-6-hydroxy-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-4-methyl-1-oxopentan-2-yl]amino]-2-hydroxy-3-oxopropyl]-2-chlorophenyl] hydrogen sulfate |
| SMILES (Canonical) | CC(C)CC(C(=O)N1C2CC(CCC2CC1C(=O)NC(CCCN=C(N)N)C=O)O)NC(=O)C(CC3=CC(=C(C=C3)OS(=O)(=O)O)Cl)O |
| SMILES (Isomeric) | CC(C)C[C@H](C(=O)N1[C@H]2C[C@@H](CC[C@H]2C[C@H]1C(=O)N[C@@H](CCCN=C(N)N)C=O)O)NC(=O)[C@@H](CC3=CC(=C(C=C3)OS(=O)(=O)O)Cl)O |
| InChI | InChI=1S/C30H45ClN6O10S/c1-16(2)10-22(36-28(42)25(40)12-17-5-8-26(21(31)11-17)47-48(44,45)46)29(43)37-23-14-20(39)7-6-18(23)13-24(37)27(41)35-19(15-38)4-3-9-34-30(32)33/h5,8,11,15-16,18-20,22-25,39-40H,3-4,6-7,9-10,12-14H2,1-2H3,(H,35,41)(H,36,42)(H4,32,33,34)(H,44,45,46)/t18-,19-,20+,22+,23-,24-,25+/m0/s1 |
| InChI Key | CUWDICYBIPXADQ-ADSAJTLWSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C30H45ClN6O10S |
| Molecular Weight | 717.20 g/mol |
| Exact Mass | 716.2606405 g/mol |
| Topological Polar Surface Area (TPSA) | 272.00 Ų |
| XlogP | 0.60 |
| Atomic LogP (AlogP) | -0.18 |
| H-Bond Acceptor | 10 |
| H-Bond Donor | 7 |
| Rotatable Bonds | 16 |
| CHEMBL564258 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.8966 | 89.66% |
| Caco-2 | - | 0.8614 | 86.14% |
| Blood Brain Barrier | - | 0.6000 | 60.00% |
| Human oral bioavailability | - | 0.7286 | 72.86% |
| Subcellular localzation | Mitochondria | 0.4766 | 47.66% |
| OATP2B1 inhibitior | + | 0.5664 | 56.64% |
| OATP1B1 inhibitior | + | 0.8525 | 85.25% |
| OATP1B3 inhibitior | + | 0.9362 | 93.62% |
| MATE1 inhibitior | - | 0.7400 | 74.00% |
| OCT2 inhibitior | - | 0.5500 | 55.00% |
| BSEP inhibitior | + | 0.8384 | 83.84% |
| P-glycoprotein inhibitior | + | 0.7340 | 73.40% |
| P-glycoprotein substrate | + | 0.8869 | 88.69% |
| CYP3A4 substrate | + | 0.7552 | 75.52% |
| CYP2C9 substrate | - | 0.6120 | 61.20% |
| CYP2D6 substrate | - | 0.8016 | 80.16% |
| CYP3A4 inhibition | - | 0.5931 | 59.31% |
| CYP2C9 inhibition | - | 0.6920 | 69.20% |
| CYP2C19 inhibition | - | 0.6236 | 62.36% |
| CYP2D6 inhibition | - | 0.8422 | 84.22% |
| CYP1A2 inhibition | - | 0.7125 | 71.25% |
| CYP2C8 inhibition | + | 0.7030 | 70.30% |
| CYP inhibitory promiscuity | - | 0.7186 | 71.86% |
| UGT catelyzed | - | 0.5000 | 50.00% |
| Carcinogenicity (binary) | - | 0.5235 | 52.35% |
| Carcinogenicity (trinary) | Non-required | 0.5753 | 57.53% |
| Eye corrosion | - | 0.9759 | 97.59% |
| Eye irritation | - | 0.9262 | 92.62% |
| Skin irritation | - | 0.7542 | 75.42% |
| Skin corrosion | - | 0.9087 | 90.87% |
| Ames mutagenesis | - | 0.6000 | 60.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.5392 | 53.92% |
| Micronuclear | + | 0.9200 | 92.00% |
| Hepatotoxicity | - | 0.5497 | 54.97% |
| skin sensitisation | - | 0.8259 | 82.59% |
| Respiratory toxicity | + | 0.8333 | 83.33% |
| Reproductive toxicity | + | 0.8889 | 88.89% |
| Mitochondrial toxicity | + | 0.7125 | 71.25% |
| Nephrotoxicity | - | 0.8098 | 80.98% |
| Acute Oral Toxicity (c) | III | 0.5804 | 58.04% |
| Estrogen receptor binding | + | 0.8213 | 82.13% |
| Androgen receptor binding | + | 0.7007 | 70.07% |
| Thyroid receptor binding | + | 0.5601 | 56.01% |
| Glucocorticoid receptor binding | + | 0.6589 | 65.89% |
| Aromatase binding | + | 0.6561 | 65.61% |
| PPAR gamma | + | 0.7120 | 71.20% |
| Honey bee toxicity | - | 0.7257 | 72.57% |
| Biodegradation | - | 0.7250 | 72.50% |
| Crustacea aquatic toxicity | - | 0.5546 | 55.46% |
| Fish aquatic toxicity | + | 0.9850 | 98.50% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3837 | P07711 | Cathepsin L | 99.96% | 96.61% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.60% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.35% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.07% | 94.45% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 97.33% | 85.31% |
| CHEMBL4072 | P07858 | Cathepsin B | 97.12% | 93.67% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.70% | 96.00% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 96.02% | 90.24% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 95.84% | 98.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.53% | 95.56% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 95.40% | 93.56% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 95.38% | 90.71% |
| CHEMBL204 | P00734 | Thrombin | 94.53% | 96.01% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 94.15% | 97.14% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 93.87% | 94.66% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 93.79% | 95.89% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 93.45% | 100.00% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 93.08% | 96.90% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 92.72% | 91.19% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 91.74% | 95.38% |
| CHEMBL5028 | O14672 | ADAM10 | 91.55% | 97.50% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.41% | 90.17% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 90.24% | 95.34% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.16% | 95.89% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 90.08% | 98.05% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 89.53% | 96.67% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 88.83% | 100.00% |
| CHEMBL238 | Q01959 | Dopamine transporter | 88.59% | 95.88% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 88.49% | 97.21% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 87.94% | 100.00% |
| CHEMBL1801 | P00747 | Plasminogen | 87.75% | 92.44% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 87.64% | 96.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.47% | 97.09% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 87.46% | 96.47% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 86.95% | 92.88% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 86.86% | 91.03% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.02% | 95.50% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 85.59% | 92.29% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 85.07% | 97.64% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.02% | 91.11% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 84.73% | 95.52% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 84.19% | 97.50% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.96% | 99.17% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 83.86% | 98.75% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.47% | 90.00% |
| CHEMBL222 | P23975 | Norepinephrine transporter | 83.39% | 96.06% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.43% | 94.33% |
| CHEMBL3891 | P07384 | Calpain 1 | 81.98% | 93.04% |
| CHEMBL3729 | P22748 | Carbonic anhydrase IV | 81.84% | 99.23% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.78% | 93.03% |
| CHEMBL4805 | Q99572 | P2X purinoceptor 7 | 81.62% | 97.50% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.90% | 89.62% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 80.36% | 95.58% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 80.33% | 93.81% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 80.15% | 98.59% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 80.01% | 96.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 45270664 |
| LOTUS | LTS0046171 |
| wikiData | Q104246329 |