Aeruginazole DA1274
| Internal ID | 1fccbd01-c8e4-4cab-9f9c-8ebe8132c20b |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | 2-[(4S,11S,14R,33S,36S,39S)-33,36-dibenzyl-39-[(2S)-butan-2-yl]-11-[(4-hydroxyphenyl)methyl]-4-(2-methylpropyl)-2,9,12,19,22,25,28,31,34,37-decaoxo-6,16,41-trithia-3,10,13,20,23,26,29,32,35,38,43,44,45-tridecazatetracyclo[38.2.1.15,8.115,18]pentatetraconta-1(42),5(45),7,15(44),17,40(43)-hexaen-14-yl]acetamide |
| SMILES (Canonical) | CCC(C)C1C2=NC(=CS2)C(=O)NC(C3=NC(=CS3)C(=O)NC(C(=O)NC(C4=NC(=CS4)C(=O)NCC(=O)NCC(=O)NCC(=O)NCC(=O)NC(C(=O)NC(C(=O)N1)CC5=CC=CC=C5)CC6=CC=CC=C6)CC(=O)N)CC7=CC=C(C=C7)O)CC(C)C |
| SMILES (Isomeric) | CC[C@H](C)[C@H]1C2=NC(=CS2)C(=O)N[C@H](C3=NC(=CS3)C(=O)N[C@H](C(=O)N[C@@H](C4=NC(=CS4)C(=O)NCC(=O)NCC(=O)NCC(=O)NCC(=O)N[C@H](C(=O)N[C@H](C(=O)N1)CC5=CC=CC=C5)CC6=CC=CC=C6)CC(=O)N)CC7=CC=C(C=C7)O)CC(C)C |
| InChI | InChI=1S/C60H70N14O12S3/c1-5-33(4)51-60-73-45(31-89-60)57(86)69-41(20-32(2)3)58-72-44(30-88-58)56(85)68-39(23-36-16-18-37(75)19-17-36)54(83)70-42(24-46(61)76)59-71-43(29-87-59)52(81)65-27-49(79)63-25-47(77)62-26-48(78)64-28-50(80)66-38(21-34-12-8-6-9-13-34)53(82)67-40(55(84)74-51)22-35-14-10-7-11-15-35/h6-19,29-33,38-42,51,75H,5,20-28H2,1-4H3,(H2,61,76)(H,62,77)(H,63,79)(H,64,78)(H,65,81)(H,66,80)(H,67,82)(H,68,85)(H,69,86)(H,70,83)(H,74,84)/t33-,38-,39-,40-,41-,42+,51-/m0/s1 |
| InChI Key | CPDCBBBFMXRHPP-IKUZVGDBSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C60H70N14O12S3 |
| Molecular Weight | 1275.50 g/mol |
| Exact Mass | 1274.44597724 g/mol |
| Topological Polar Surface Area (TPSA) | 478.00 Ų |
| XlogP | 3.90 |
| 2-[(4S,11S,14R,33S,36S,39S)-33,36-dibenzyl-39-[(2S)-butan-2-yl]-11-[(4-hydroxyphenyl)methyl]-4-(2-methylpropyl)-2,9,12,19,22,25,28,31,34,37-decaoxo-6,16,41-trithia-3,10,13,20,23,26,29,32,35,38,43,44,45-tridecazatetracyclo[38.2.1.15,8.115,18]pentatetraconta-1(42),5(45),7,15(44),17,40(43)-hexaen-14-yl]acetamide |
| 2-((4S,11S,14R,33S,36S,39S)-33,36-dibenzyl-39-((2S)-butan-2-yl)-11-((4-hydroxyphenyl)methyl)-4-(2-methylpropyl)-2,9,12,19,22,25,28,31,34,37-decaoxo-6,16,41-trithia-3,10,13,20,23,26,29,32,35,38,43,44,45-tridecazatetracyclo(38.2.1.15,8.115,18)pentatetraconta-1(42),5(45),7,15(44),17,40(43)-hexaen-14-yl)acetamide |
| RefChem:109877 |
| 2-((12Z,52Z,122Z,4S,8S,11R,27S,30S,33S)-27,30-dibenzyl-33-((S)-sec-butyl)-8-(4-hydroxybenzyl)-4-isobutyl-2,6,9,13,16,19,22,25,28,31-decaoxo-3,7,10,14,17,20,23,26,29,32-decaaza-1(4,2),5,12(2,4)-trithiazolacyclotritriacontaphane-11-yl)acetamide |
| CHEBI:204869 |
| DTXSID601046895 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.64% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.17% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.41% | 90.17% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 95.72% | 95.50% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.57% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.31% | 86.33% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 94.02% | 93.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.66% | 94.75% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 92.10% | 97.64% |
| CHEMBL4071 | P08311 | Cathepsin G | 91.50% | 94.64% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.83% | 95.56% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 90.53% | 95.93% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.00% | 91.11% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 88.10% | 93.03% |
| CHEMBL4447 | Q9Y337 | Kallikrein 5 | 87.14% | 87.50% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.99% | 97.25% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 86.84% | 90.08% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 86.28% | 83.10% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.01% | 98.75% |
| CHEMBL3891 | P07384 | Calpain 1 | 84.50% | 93.04% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.14% | 99.23% |
| CHEMBL268 | P43235 | Cathepsin K | 83.13% | 96.85% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 82.56% | 85.11% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 82.53% | 89.44% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 82.41% | 94.62% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 82.21% | 82.86% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.82% | 97.09% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 81.63% | 89.67% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 81.57% | 80.71% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.90% | 90.71% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 80.82% | 95.00% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 80.72% | 93.10% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.60% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 57328241 |
| LOTUS | LTS0131831 |
| wikiData | Q77420601 |