2-hydroxy-3a,5a,5b,8,8,11a-hexamethyl-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-9-one
Internal ID | 7b42f92f-75e1-464d-9760-314ba4a8e62a |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | 2-hydroxy-3a,5a,5b,8,8,11a-hexamethyl-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-9-one |
SMILES (Canonical) | CC(=C)C1C(CC2(C1C3CCC4C5(CCC(=O)C(C5CCC4(C3(CC2)C)C)(C)C)C)C)O |
SMILES (Isomeric) | CC(=C)C1C(CC2(C1C3CCC4C5(CCC(=O)C(C5CCC4(C3(CC2)C)C)(C)C)C)C)O |
InChI | InChI=1S/C30H48O2/c1-18(2)24-20(31)17-27(5)15-16-29(7)19(25(24)27)9-10-22-28(6)13-12-23(32)26(3,4)21(28)11-14-30(22,29)8/h19-22,24-25,31H,1,9-17H2,2-8H3 |
InChI Key | NVVNESBGININNL-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H48O2 |
Molecular Weight | 440.70 g/mol |
Exact Mass | 440.365430770 g/mol |
Topological Polar Surface Area (TPSA) | 37.30 Ų |
XlogP | 8.20 |
There are no found synonyms. |
![2D Structure of 2-hydroxy-3a,5a,5b,8,8,11a-hexamethyl-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-9-one 2D Structure of 2-hydroxy-3a,5a,5b,8,8,11a-hexamethyl-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-9-one](https://plantaedb.com/storage/docs/compounds/2023/11/aea86410-85b2-11ee-b2f3-e18917889da3.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 94.41% | 92.94% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 94.04% | 94.75% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.71% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.23% | 94.45% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 91.38% | 82.69% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.09% | 96.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.83% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 88.56% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.61% | 97.25% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 83.93% | 91.24% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 83.47% | 95.38% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.85% | 93.04% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.31% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.16% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.47% | 95.89% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.34% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Salacia beddomei |
PubChem | 162976866 |
LOTUS | LTS0177531 |
wikiData | Q105186444 |